DrugPatentWatch Database Preview
Acetaminophen - Generic Drug Details
Join the DrugPatentWatch Referral Program Get access to a free drug patent landscape report or a free one-month subscription
What are the generic sources for acetaminophen and what is the scope of freedom to operate?
Acetaminophen
is the generic ingredient in one hundred and four branded drugs marketed by Ortho Mcneil Pharm, Custopharm Inc, Fresenius Kabi Usa, Sandoz Inc, Mallinckrodt Hosp, Acp Nimble, Able, Acino Prods, Perrigo New York, Taro Pharm Inds Ltd, Polymedica, J And J Consumer Inc, Aurobindo Pharma Ltd, Granules India Ltd, Heritage Pharma, Ohm Labs, Perrigo, Sun Pharm Inds Ltd, Glaxosmithkline Cons, Mikart, Scherer Labs, Kvk Tech Inc, Forest Pharms, Mallinckrodt, Granules Pharms, Mayne Pharma Inc, Valeant, Dunhall, Larken Labs Inc, Cnty Line Pharms, Halsey, Nexgen Pharma, Watson Labs, Mayrand, Shire, Aurolife Pharma Llc, Gilbert Labs, Graham Dm, Hikma Pharms, Nuvo Pharms Inc, Wraser Pharms Llc, Us Chem, Abhai Llc, Actavis Labs Ut Inc, Lannett Co Inc, Mirror Pharms Llc, Nexgen Pharma Inc, Novast Labs, Specgx Llc, Sun Pharm Industries, Vintage Pharms, Hikma Intl Pharms, Pharm Res Assoc, Leitner Pharms, Boca Pharma Llc, West-ward Pharm Corp, Novartis, Teva, Robins Ah, Solvay, Aci Healthcare Ltd, Actavis Mid Atlantic, Anda Repository, Dava Pharms Inc, Hi Tech Pharma, Pharm Assoc, Wockhardt Bio Ag, Valeant Pharms Llc, Am Therap, Amneal Pharms Ny, Duramed Pharms Barr, Elite Labs Inc, Everylife, Eywa, Fosun Pharma, Kv Pharm, Lederle, Mutual Pharm, Puracap Pharm, Purepac Pharm, Rhodes Pharms, Roxane, Sandoz, Superpharm, Usl Pharma, Valeant Pharm Intl, Vintage, Vitarine, Warner Chilcott, Watson Labs Florida, Whiteworth Town Plsn, Carnrick, Glaxosmithkline, Vangard, Janssen Pharms, Schering Plough, Cent Pharms, Ivax Pharms, Genus, Mallinckrodt Inc, Nesher Pharms, Vistapharm, Wes Pharma Inc, Cypress Pharm Inc, Ucb Inc, Ascher, Actavis Labs Fl Inc, Alvogen Pine Brook, Amneal Pharms, Apil, Ascent Pharms Inc, Barr, Caraco, Epic Pharma Llc, Novel Labs Inc, Par Pharm, Ranbaxy, Ranbaxy Labs Ltd, Sun Pharm Inds Inc, Tris Pharma Inc, Upsher Smith Labs, Vintage Pharms Llc, Abana, Abbott, Abbvie, Actavis Elizabeth, Mikart Inc, Hikma, Bristol Myers Squibb, Alvogen, Xiromed, Gavis Pharms, Sanofi Aventis Us, Aaipharma Llc, Mylan, Xanodyne Pharm, Cornerstone, Ivax Sub Teva Pharms, Mirror Pharms, Mylan Pharms Inc, Wockhardt Ltd, Alkem Labs Ltd, Apotex, Cspc Ouyi, Macleods Pharms Ltd, Micro Labs Ltd India, and Zydus Pharms Usa Inc, and is included in four hundred and eighty-three NDAs. There are twenty-four patents protecting this compound and one Paragraph IV challenge. Additional information is available in the individual branded drug profile pages.Acetaminophen has thirty-five patent family members in twenty-four countries.
There are sixty-six drug master file entries for acetaminophen. Fifty-seven suppliers are listed for this compound. There is one tentative approval for this compound.
Summary for acetaminophen
| International Patents: | 35 |
| US Patents: | 24 |
| Tradenames: | 104 |
| Applicants: | 147 |
| NDAs: | 483 |
| Drug Master File Entries: | 66 |
| Suppliers / Packagers: | 57 |
| Bulk Api Vendors: | 136 |
| Clinical Trials: | 955 |
| Patent Applications: | 8,022 |
| Formulation / Manufacturing: | see details |
| Drug Prices: | Drug price trends for acetaminophen |
| Drug Sales Revenues: | Drug sales revenues for acetaminophen |
| Patent Litigation and PTAB cases: | See patent lawsuits and PTAB cases for acetaminophen |
| DailyMed Link: | acetaminophen at DailyMed |
Recent Clinical Trials for acetaminophen
Identify potential brand extensions & 505(b)(2) entrants
| Sponsor | Phase |
|---|---|
| Hoffmann-La Roche | Phase 3 |
| Lawson Health Research Institute | Phase 2 |
| Ontario Institute for Cancer Research | Phase 2 |
Recent Litigation for acetaminophen
Identify potential future generic entrants
District Court Litigation
| Case Name | Date |
|---|---|
| Mallinckrodt Hospital Products IP Limited v. Altan Pharma Ltd. | 2019-03-22 |
| Mallinckrodt Hospital Products IP Ltd. v. B. Braun Medical Inc. | 2018-07-24 |
| Mallinckrodt IP Unlimited Company v. Aurobindo Pharma USA, Inc. | 2017-12-29 |
Generic filers with tentative approvals for ACETAMINOPHEN
| Applicant | Application No. | Strength | Dosage Form |
| Start Trial | Start Trial | 325MG; 7.5MG | TABLET, EXTENDED RELEASE;ORAL |
The 'tentative' approval signifies that the product meets all FDA standards for marketing, and, but for the patents / regulatory protections, it would approved.
Medical Subject Heading (MeSH) Categories for acetaminophen
Synonyms for acetaminophen
| 103-90-2 |
| 1430221-00-3 |
| 222 AF |
| 362O9ITL9D |
| 4 inverted exclamation marka-Hydroxyacetanilide; 4-Acetamidophenol; N-Acetyl-4-aminophenol; APAP |
| 4-(Acetylamino)phenol |
| 4-(N-Acetylamino)phenol |
| 4-13-00-01091 (Beilstein Handbook Reference) |
| 4-acetamido phenol |
| 4-acetamido-phenol |
| 4-Acetamidophenol |
| 4-Acetamidophenol, 98% |
| 4-Acetamino phenol |
| 4-Acetaminophenol |
| 4-acetominophenol |
| 4-acetylaminophenol |
| 4-Hydroxyacetanilide |
| 4-Hydroxyanilid kyseliny octove |
| 4-Hydroxyanilid kyseliny octove [Czech] |
| 4'-Hydroxyacetanilide |
| 6473-EP1441224A2 |
| 6473-EP2270008A1 |
| 6473-EP2272832A1 |
| 6473-EP2275420A1 |
| 6473-EP2277565A2 |
| 6473-EP2277566A2 |
| 6473-EP2277567A1 |
| 6473-EP2277568A2 |
| 6473-EP2277569A2 |
| 6473-EP2277570A2 |
| 6473-EP2277861A1 |
| 6473-EP2277865A1 |
| 6473-EP2277875A2 |
| 6473-EP2280008A2 |
| 6473-EP2281559A1 |
| 6473-EP2281819A1 |
| 6473-EP2281823A2 |
| 6473-EP2292280A1 |
| 6473-EP2292617A1 |
| 6473-EP2292619A1 |
| 6473-EP2298764A1 |
| 6473-EP2298765A1 |
| 6473-EP2305219A1 |
| 6473-EP2305654A1 |
| 6473-EP2305659A1 |
| 6473-EP2308510A1 |
| 6473-EP2308872A1 |
| 6473-EP2311818A1 |
| 6473-EP2314585A1 |
| 6473-EP2314590A1 |
| 6473-EP2316829A1 |
| 6473-EP2371811A2 |
| 719293-04-6 |
| 72238-EP2305640A2 |
| 72238-EP2308867A2 |
| 72238-EP2308870A2 |
| 8055-08-1 |
| 91399-EP2277876A1 |
| 91399-EP2284149A1 |
| 91399-EP2292614A1 |
| 91399-EP2305636A1 |
| A-Per |
| A.F. Anacin |
| AB00051905 |
| AB00051905_10 |
| AB00051905-09 |
| AB1009347 |
| Abenol |
| Abensanil |
| Abrol |
| Abrolet |
| AC-23969 |
| AC1L1CNW |
| AC1Q1KYJ |
| AC1Q1KYK |
| Acamol |
| Accu-Tap |
| Acenol |
| Acenol (pharmaceutical) |
| Acertol |
| Aceta Elixir |
| Aceta Tablets |
| Acetaco |
| Acetagesic |
| Acetalgin |
| Acetamide, N-(4-hydroxyphenyl)- |
| Acetamide, N-(p-hydroxyphenyl)- |
| Acetaminofen |
| Acetaminophen (4-hydroxyacetanilide) |
| Acetaminophen (JP17/USP) |
| Acetaminophen [USP:JAN] |
| Acetaminophen [USP] |
| Acetaminophen 650 |
| Acetaminophen solution, 1.0 mg/mL in methanol, ampule of 1 mL, certified reference material |
| Acetaminophen solution, drug standard, 1.0 mg/mL in methanol |
| Acetaminophen Uniserts |
| Acetaminophen, analytical standard |
| Acetaminophen, BioXtra, >=99.0% |
| Acetaminophen, meets USP testing specifications, 98.0-102.0%, powder |
| Acetaminophen, Pharmaceutical Secondary Standard; Certified Reference Material |
| Acetaminophen, United States Pharmacopeia (USP) Reference Standard |
| acetaminophene |
| acetaminophenol |
| Acetamol |
| Acetanilide, 4'-hydroxy- |
| Acetavance |
| Acetofen |
| Acetominophen |
| acetominophene |
| ACMC-20989w |
| ACT06727 |
| Actamin |
| Actamin Extra |
| Actamin Super |
| Actifed Plus |
| Actifed Plus (Salt/Mix) |
| Actimol |
| Actimol Chewable Tablets |
| Actimol Children's Suspension |
| Actimol Infants' Suspension |
| Actimol Junior Strength Caplets |
| Afebrin |
| Afebryl |
| Aferadol |
| AJ-70539 |
| AKOS000121004 |
| Algesidal |
| Algina |
| Algomol |
| Algotropyl |
| Allay |
| alpha-Per |
| Alpiny |
| Alpinyl |
| Alvedon |
| Amadil |
| Aminofen |
| Aminofen Max |
| AN-24662 |
| Anacin-3 |
| Anacin-3 Extra Strength |
| Anadin dla dzieci |
| Anaflon |
| Analter |
| Anapap |
| Andox |
| Anelix |
| Anexsia |
| Anexsia (Salt/Mix) |
| ANEXSIA 10/660 |
| Anhiba |
| Anti-Algos |
| Antidol |
| Anuphen |
| ANW-14994 |
| Apacet |
| Apacet Capsules |
| Apacet Elixir |
| Apacet Extra Strength Caplets |
| Apacet Extra Strength Tablets |
| Apacet Regular Strength Tablets |
| Apadon |
| Apamid |
| Apamide |
| APAP |
| APAP, Paracetamol |
| Apitrelal |
| Apo-Acetaminophen |
| Arfen |
| Arthralgen |
| Asetam |
| Asomal |
| Aspac |
| Aspirin Free Anacin Maximum Strength Caplets |
| Aspirin Free Anacin Maximum Strength Gel Caplets |
| Aspirin Free Anacin Maximum Strength Tablets |
| Aspirin-Free Anacin |
| Aspirin-Free Anacin (Salt/Mix) |
| Aspirin-Free Excedrin Caplets |
| Asplin |
| Atasol |
| Atasol Caplets |
| Atasol Drops |
| Atasol Forte Caplets |
| Atasol Forte Tablets |
| Atasol Oral Solution |
| Atasol Tablets |
| Atralidon |
| Babikan |
| Bacetamol |
| Banesin |
| Bayer Select |
| Bayer Select Allergy-Sinus |
| Bayer Select Allergy-Sinus (Salt/Mix) |
| Bayer Select Head Cold |
| Bayer Select Head Cold (Salt/Mix) |
| Bayer Select Headache Pain |
| Bayer Select Maximum Strength Headache Pain Relief Formula |
| Bayer Select Menstrual Multi-Symptom |
| Bayer Select Menstrual Multi-Symptom (Salt/Mix) |
| Bayer Select Sinus Pain Relief |
| Bayer Select Sinus Pain Relief (Salt/Mix) |
| BBL005229 |
| BC204766 |
| BCP0726000305 |
| BCP23431 |
| BCP9000225 |
| BCPP000441 |
| BDBM26197 |
| Ben-u-ron |
| Benmyo |
| Bickie-mol |
| BIDD:GT0005 |
| Biocetamol |
| BPBio1_001007 |
| BRD-K41524689-001-08-6 |
| BSPBio_000915 |
| BSPBio_001786 |
| Bucet |
| Butapap |
| C06804 |
| Cadafen |
| Calapol |
| Calmanticold |
| Calonal |
| Calpol |
| Calpol infant |
| Capital |
| Capital with Codeine |
| Captin |
| CAS-103-90-2 |
| Causalon |
| CCG-38901 |
| CCRIS 3 |
| Cefalex |
| Cetadol |
| CHEBI:46195 |
| CHEMBL112 |
| Children's Acetaminophen Elixir Drops |
| Children's Acetaminophen Elixir Solution |
| Children's Acetaminophen Oral Solution |
| Children's Tylenol Chewable |
| Citramon P |
| CJ-15887 |
| Claradol Codeine |
| Claratal |
| Clixodyne |
| Co-Gesic |
| Cod-Acamol Forte |
| Codabrol |
| Codalgin |
| Codapane |
| Codicet |
| Codisal |
| Codisal Forte |
| Codoliprane |
| Codral Pain Relief |
| Cofamol |
| component of Dialog |
| component of Dilone |
| component of Endecon |
| component of Hycomine Compound |
| component of Percocet |
| component of Percogesic |
| component of Phenaphen |
| Conacetol |
| Contac Cough & Sore Throat Formula |
| Contac Cough & Sore Throat Formula (Salt/Mix) |
| Contra-Schmerz P |
| Coricidin (Salt/Mix) |
| Coricidin D |
| Coricidin D (Salt/Mix) |
| Coricidin Sinus |
| Coricidin Sinus (Salt/Mix) |
| Cosutone |
| Croix Blanche |
| CS-2819 |
| CTK3J2516 |
| Cuponol |
| Curadon |
| Curpol |
| Custodial |
| D oliprane |
| D00217 |
| Dafalgan |
| Dafalgan Codeine |
| Daga |
| Dapa X-S |
| Daphalgan |
| Darocet |
| Darvocet |
| Darvocet-N (Salt/Mix) |
| Datril |
| Datril Extra-Strength |
| Daygrip |
| DB00316 |
| DDS-06A |
| Demilets |
| Demilets (Salt/Mix) |
| Deminofen |
| Democyl |
| Demogripal |
| Desfebre |
| Dhamol |
| Dial-A-Gesic |
| Dial-alpha-gesic |
| Dimindol |
| Dirox |
| Disprol |
| DivK1c_000660 |
| Dol-Stop |
| Dolcor |
| Dolefin |
| Dolegrippin |
| Dolene AP-65 |
| Dolgesic |
| Doliprane |
| Dolko |
| Dolofugin |
| Doloreduct |
| Dolorfug |
| Dolorol Forte |
| Dolorstop |
| Dolotec |
| Dolprone |
| Dorocoff |
| Dresan |
| Dristan Cold No Drowsiness |
| Dristancito |
| Drixoral Cold & Flu |
| Drixoral Cold & Flu (Salt/Mix) |
| Drixoral Plus |
| Drixoral Sinus |
| Drixoral Sinus (Salt/Mix) |
| DSSTox_CID_6 |
| DSSTox_GSID_20006 |
| DSSTox_RID_75318 |
| DTXSID2020006 |
| Duaneo |
| Dularin |
| Duorol |
| Duracetamol |
| Durapan |
| Dymadon |
| Dymadon Co |
| Dymadon Forte |
| Dypap |
| EBD5728 |
| EC 203-157-5 |
| Ecosetol |
| EINECS 203-157-5 |
| Elixodyne |
| Empracet |
| Empracet (Salt/Mix) |
| Endecon |
| Endecon (Salt/Mix) |
| Enelfa |
| Eneril |
| Epitope ID:117710 |
| Eu-Med |
| Excedrin |
| Excedrin Caplets |
| Excedrin Extra Strength Caplets |
| Excipain |
| Exdol |
| Exdol Strong |
| F3096-1731 |
| F48B493F-B1FD-410C-AA0A-F40EC71A0689 |
| Fanalgic |
| Farmadol |
| Febranine |
| Febrectal |
| Febrectol |
| Febrex |
| Febricet |
| Febridol |
| Febrilix |
| Febrin |
| Febrinol |
| Febro-Gesic |
| Febrolin |
| Fendon |
| Fensum |
| Fepanil |
| Fever All |
| Feverall Junior Strength |
| Feverall Sprinkle Caps Junior Strength |
| Fevor |
| Finimal |
| Finiweh |
| Flexsure |
| Fluparmol |
| Fortalidon P |
| Freka-cetamol |
| FT-0658035 |
| Gattaphen T |
| Gelocatil |
| Geluprane |
| Genapap |
| Genapap Children's Elixir |
| Genapap Children's Tablets |
| Genapap Extra Strength Caplets |
| Genapap Extra Strength Tablets |
| Genapap Regular Strength Tablets |
| Genebs |
| Genebs Extra Strength Caplets |
| Genebs Regular Strength Tablets |
| Genebs X-Tra |
| Geralgine-P |
| Gripin Bebe |
| Grippostad |
| GTPL5239 |
| Gynospasmine |
| H865 |
| Hedex |
| Helon N |
| HMS1570N17 |
| HMS1920A03 |
| HMS2091G03 |
| HMS2097N17 |
| HMS2269G20 |
| HMS3268A10 |
| HMS3714N17 |
| HMS502A22 |
| Homoolan |
| HSDB 3001 |
| HY-66005 |
| Hy-Phen |
| Hy-Phen (Salt/Mix) |
| I05-0086 |
| IDI1_000660 |
| Ildamol |
| Inalgex |
| InChI=1/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10 |
| Infadrops |
| INFANTS' FEVERALL |
| Influbene N |
| Injectapap |
| Intensin |
| Intensin (Salt/Mix) |
| IV-APAP |
| J-001064 |
| J-514275 |
| Janupap |
| Jin Gang |
| Junior Disprol |
| Kataprin |
| KB-188932 |
| KB-192758 |
| KB-74449 |
| KBio1_000660 |
| KBio2_000356 |
| KBio2_002924 |
| KBio2_005492 |
| KBio3_001286 |
| KBioGR_000560 |
| KBioSS_000356 |
| Kinder Finimal |
| Korum |
| Kratofin simplex |
| KS-000002NN |
| KSC492K1N |
| L024125 |
| Labamol |
| Lekadol |
| Lemgrip |
| Lemsip |
| Lestemp |
| Liqiprine |
| Liquagesic |
| Liquigesic Co |
| Liquiprin (Salt/Mix) |
| Liquiprin Children's Elixir |
| Liquiprin Infants" Drops |
| Lonarid |
| Lonarid Mono |
| LS-32 |
| Lupocet |
| Lyteca |
| Lyteca Syrup |
| Magnidol |
| Malex N |
| Malgis |
| Malidens |
| Maxadol |
| MCULE-3844920617 |
| Medinol Paediatric |
| Medocodene |
| Melabon Infantil |
| Mexalen |
| MFCD00002328 |
| Midol PM Night Time Formula |
| Midol PM Night Time Formula (Salt/Mix) |
| Midol Regular Strength |
| Midol Regular Strength (Salt/Mix) |
| Midol Teen Formula |
| Midol Teen Formula (Salt/Mix) |
| Migraleve Yellow |
| Minafen |
| Minoset |
| Miralgin |
| MLS001146925 |
| MLS001331684 |
| MLS002154041 |
| MolPort-000-150-777 |
| Momentum |
| Mono Praecimed |
| Multin |
| N-(4-hydroxyphenyl)-acetamide |
| N-(4-Hydroxyphenyl)acetamide |
| N-(4-Hydroxyphenyl)acetamide (Tylenol) |
| N-(4-Hydroxyphenyl)acetanilide |
| N-(4-hydroxyphenyl)ethanamide |
| N-acetyl para aminophenol |
| N-Acetyl-4-aminophenol |
| n-acetyl-4-hydroxyaniline |
| N-acetyl-4-hydroxyaniline; |
| N-Acetyl-p-aminophenol |
| N-acetyl-para-aminophenol |
| Naldegesic |
| Naldegesic (Salt/Mix) |
| Napafen |
| NAPAP |
| Naprinol |
| NCGC00016361-01 |
| NCGC00016361-02 |
| NCGC00016361-03 |
| NCGC00016361-04 |
| NCGC00016361-05 |
| NCGC00016361-06 |
| NCGC00016361-07 |
| NCGC00016361-08 |
| NCGC00016361-09 |
| NCGC00016361-10 |
| NCGC00016361-12 |
| NCGC00016361-13 |
| NCGC00025267-01 |
| NCGC00025267-02 |
| NCGC00025267-03 |
| NCGC00025267-04 |
| NCGC00025267-05 |
| NCGC00253912-01 |
| NCGC00259479-01 |
| NCI-C55801 |
| NCX 701 |
| Nealgyl |
| NEBS |
| Neo-Fepramol |
| NeoCitran |
| Neodol |
| Neodolito |
| Neopap |
| Neotrend |
| Neuridon |
| New Cortal for Children |
| NilnOcen |
| Nina |
| NINDS_000660 |
| No-Febril |
| Nobedon |
| Nodolex |
| Noral |
| Norco |
| NSC 109028 |
| NSC 3991 |
| NSC-109028 |
| NSC-3991 |
| NSC-755853 |
| NSC109028 |
| NSC3991 |
| NSC755853 |
| Ofirmev |
| Oltyl |
| Oralgan |
| Oraphen-PD |
| Ornex Severe Cold Formula (Salt/Mix) |
| Ortensan |
| Oxycocet |
| p-(Acetylamino)phenol |
| p-Acetamidophenol |
| p-Acetaminophenol |
| p-Acetoaminophen |
| p-Acetylaminophenol |
| p-hydroxy-acetanilid |
| p-Hydroxyacetanilide |
| p-hydroxyacetoanilide |
| p-Hydroxyphenolacetamide |
| Paceco |
| Pacemo |
| Pacemol |
| Pacet |
| Pacimol |
| Paedialgon |
| Paedol |
| Painex |
| Paldesic |
| Pamol |
| Panacete |
| Panadeine |
| Panadeine Co |
| Panadiene |
| Panado-Co |
| Panado-Co Caplets |
| Panadol |
| Panadol Extra Strength |
| Panadol Junior Strength Caplets |
| Panadol Maximum Strength Caplets |
| Panadol Maximum Strength Tablets |
| Panale ve |
| Panaleve |
| Panamax |
| Panasorb |
| Panasorbe |
| Panets |
| Panex |
| Panodil |
| Panofen |
| Pantalgin |
| Papa-Deine |
| para-acetylaminophenol |
| Para-Suppo |
| Para-Tabs |
| Paracemol |
| Paracenol |
| Paracet |
| Paracetamol |
| paracetamol (acetaminophen) |
| Paracetamol (Acetaminophen) 1.0 mg/ml in Methanol |
| Paracetamol (INN) |
| Paracetamol [INN:BAN] |
| Paracetamol AL |
| Paracetamol Antipanin P |
| Paracetamol Basics |
| Paracetamol BC |
| Paracetamol DC |
| Paracetamol Dr. Schmidgall |
| Paracetamol Fecofar |
| Paracetamol for equipment qualification, EuropePharmacopoeia (EP) Reference Standard |
| Paracetamol Genericon |
| Paracetamol Hanseler |
| Paracetamol Harkley |
| Paracetamol Heumann |
| Paracetamol Hexal |
| Paracetamol Italfarmaco |
| Paracetamol Nycomed |
| Paracetamol PB |
| Paracetamol Raffo |
| Paracetamol Ratiopharm |
| Paracetamol Rosch |
| Paracetamol Saar |
| Paracetamol SmithKline Beecham |
| Paracetamol Stada |
| Paracetamol von ct |
| Paracetamol Winthrop |
| Paracetamol, British Pharmacopoeia (BP) Reference Standard |
| Paracetamol, European Pharmacopoeia (EP) Reference Standard |
| Paracetamole |
| Paracetamolo |
| Paracetamolo [Italian] |
| Paracetamolum |
| Paracetamolum [INN-Latin] |
| Paracetanol |
| Paracetol |
| Paracin |
| Paracod |
| Paracodol |
| Parador |
| Paradrops |
| Parakapton |
| Parake |
| Paralen |
| Paralief |
| Paralink |
| Paralyoc |
| Paramol |
| Paramolan |
| Paranox |
| Parapan |
| Parasedol |
| Parasin |
| Paraspen |
| Parcetol |
| Parelan |
| Parmol |
| Parogal |
| Paroma |
| Pasolind |
| Pasolind N |
| PCM Paracetamol Lichtenstein |
| Pe-Tam |
| Pediapirin |
| Pediatrix |
| Pedric |
| Percocet-5 |
| Percocet-Demi |
| Percogesic with Codeine |
| Perdolan Mono |
| Perfalgan |
| Pharmakon1600-01500101 |
| Phenaphen |
| Phenaphen Caplets |
| Phenaphen W/Codeine |
| Phendon |
| Phenipirin |
| phenol derivative, 11 |
| Phenol, p-acetamido- |
| Phogoglandin |
| Phrenilin |
| Phrenilin Forte |
| Pinex |
| Piramin |
| Pirinasol |
| Plicet |
| Polmofen |
| Predimol |
| Predualito |
| Prestwick_13 |
| Prestwick0_000868 |
| Prestwick1_000868 |
| Prestwick2_000868 |
| Prestwick3_000868 |
| Prodol |
| Prompt |
| Prontina |
| Propacet (Salt/Mix) |
| Propacet 100 |
| Proval #3 |
| Proxyphene/Acetamine |
| PubChem17726 |
| Puernol |
| Pulmofen |
| Pyregesic-C |
| Pyrigesic |
| Pyrinazine |
| Pyromed |
| Quiet World |
| Quiet World (Salt/Mix) |
| Redutemp |
| Reliv |
| Remedol |
| Resfenol |
| Resprin |
| Rhinex D-Lay Tablets |
| Rivalgyl |
| Robigesic |
| Robitussin Night Relief |
| Robitussin Night Relief (Salt/Mix) |
| Rockamol Plus |
| Rounox |
| Roxicet 5/500 |
| RP21489 |
| RTR-000905 |
| RubieMol |
| Rubophen |
| Rupemol |
| RZVAJINKPMORJF-UHFFFAOYSA-N |
| Salzone |
| Sanicet |
| Sanicopyrine |
| SBB043758 |
| SBI-0051269.P003 |
| SC-19146 |
| Scanol |
| Scentalgyl |
| SCHEMBL19474893 |
| SCHEMBL3480 |
| Scherzatabletten Rezeptur 534 |
| Schmerzex |
| Sedalito |
| Sedapap |
| Semolacin |
| Servigesic |
| Seskamol |
| Setakop |
| Setamol |
| Setol |
| SGCUT00014 |
| Sifenol |
| Sinaspril |
| Sine-Aid, Maximum Strength (Salt/Mix) |
| Sine-Off Sinus Medicine Caplets |
| Sine-Off Sinus Medicine Caplets (Salt/Mix) |
| Sinedol |
| Sinmol |
| Sinubid (Salt/Mix) |
| SK-Apap |
| SMR000112065 |
| Snaplets-FR |
| Spalt fur die nacht |
| Spalt N |
| SPBio_000010 |
| SPBio_002836 |
| Spectrum_000016 |
| SPECTRUM1500101 |
| Spectrum2_000085 |
| Spectrum3_000283 |
| Spectrum4_000140 |
| Spectrum5_000736 |
| SR-01000597517 |
| SR-01000597517-1 |
| SR-01000597517-2 |
| SR-01000597517-4 |
| St Joseph Aspirin-Free |
| St Joseph Aspirin-Free for Children |
| St. Joseph Cold Tablets for Children |
| St. Joseph Cold Tablets for Children (Salt/Mix) |
| St. Joseph Fever Reducer |
| ST24028862 |
| ST45179777 |
| Stanback |
| STL140694 |
| Stopain |
| STR00901 |
| Sudafed Severe Cold Formula |
| Sudafed Severe Cold Formula (Salt/Mix) |
| Sudafed Sinus |
| Sudafed Sinus (Salt/Mix) |
| Sunetheton |
| Supac (Salt/Mix) |
| Supadol mono |
| Supofen |
| Suppap |
| Suppap-120 |
| Suppap-325 |
| Suppap-650 |
| Supramol-M |
| Synalgos-Dc-A |
| Tabalgin |
| Tachiprina |
| Talacen (Salt/Mix) |
| Tapanol |
| Tapanol Extra Strength Caplets |
| Tapanol Extra Strength Tablets |
| Tapar |
| Tavist Allergy/Sinus/Headache |
| Tazamol |
| Temlo |
| Tempanal |
| Tempra |
| Tempra Caplets |
| Tempra Chewable Tablets |
| Tempra D.S |
| Tempra Drops |
| Tempra Syrup |
| Tencon |
| Termacet |
| Termalgin |
| Termalgine |
| Termofren |
| Theraflu |
| TheraFlu (Salt/Mix) |
| Tiffy |
| Titralgan |
| to_000023 |
| Tocris-1706 |
| Tox21_110397 |
| Tox21_110397_1 |
| Tox21_201930 |
| Tox21_300100 |
| Toximer P |
| TR-000905 |
| TRA0127672 |
| Tralgon |
| Treupel mon |
| Treupel N |
| Treuphadol |
| Triaminic Sore Throat Formula |
| Triaminic Sore Throat Formula (Salt/Mix) |
| Triaprin |
| Tricoton |
| Tussapap |
| Ty lenol |
| Tycolet |
| TYL |
| Tylenol |
| Tylenol (caplet) |
| Tylenol (geltab) |
| Tylenol (TN) |
| Tylenol (USA), Anacin Aspirin Free (USA), Apra (USA), Crocin (India), Feverall (USA), Genapap (USA), Panadol (UK), Panamax (Australia), Panodil (Denmark) |
| Tylenol 8-Hour |
| Tylenol Allergy Sinus |
| Tylenol Allergy Sinus (Salt/Mix) |
| Tylenol Arthritis Extended Relief |
| Tylenol Caplets |
| Tylenol Children's Chewable Tablets |
| Tylenol Children's Elixir |
| Tylenol Children's Suspension Liquid |
| Tylenol Drops |
| Tylenol Elixir |
| Tylenol Extra Strength Adult Liquid Pain Reliever |
| Tylenol Extra Strength Caplets |
| Tylenol Extra Strength Gelcaps |
| Tylenol Extra Strength Tablets |
| Tylenol Gelcaps |
| Tylenol Infants Drops |
| Tylenol Infants" Suspension Drops |
| Tylenol Junior Strength Caplets |
| Tylenol Junior Strength Chewable Tablets |
| Tylenol Regular Strength Caplets |
| Tylenol Regular Strength Tablets |
| Tylenol Tablets |
| Tylex |
| Tylex CD |
| Tylol |
| Tylox (Salt/Mix) |
| Tymol |
| Unavailable - See ASDI_CatNo 500008847 |
| UNII-362O9ITL9D |
| Upsanol |
| Utragin |
| Valadol |
| Valgesic |
| Valorin |
| Valorin Extra |
| Veralgina |
| Vermidon |
| Verpol |
| Viclor Richet |
| Vicodin |
| Vicodin (Salt/Mix) |
| Vips |
| Viruflu |
| Vivimed |
| Volpan |
| WLN: QR DMV1 |
| Wygesic |
| Wygesic (Salt/Mix) |
| Zatinol |
| ZINC13550868 |
| Zolben |
| Zydone (Salt/Mix) |
Paragraph IV (Patent) Challenges for ACETAMINOPHEN
| Tradename | Dosage | Ingredient | NDA | Submissiondate |
|---|---|---|---|---|
| OFIRMEV | SOLUTION;INTRAVENOUS | acetaminophen | 022450 | 2011-04-07 |
| TYLENOL | TABLET, EXTENDED RELEASE;ORAL | acetaminophen | 019872 |
US Patents and Regulatory Information for acetaminophen
Expired US Patents for acetaminophen
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | Patent No. | Patent Expiration |
|---|---|---|---|---|---|---|---|
| J And J Consumer Inc | TYLENOL | acetaminophen | TABLET, EXTENDED RELEASE;ORAL | 019872-001 | Jun 8, 1994 | Start Trial | Start Trial |
| Mallinckrodt Hosp | OFIRMEV | acetaminophen | SOLUTION;INTRAVENOUS | 022450-001 | Nov 2, 2010 | Start Trial | Start Trial |
| J And J Consumer Inc | TYLENOL | acetaminophen | TABLET, EXTENDED RELEASE;ORAL | 019872-001 | Jun 8, 1994 | Start Trial | Start Trial |
| J And J Consumer Inc | TYLENOL | acetaminophen | TABLET, EXTENDED RELEASE;ORAL | 019872-001 | Jun 8, 1994 | Start Trial | Start Trial |
| >Applicant | >Tradename | >Generic Name | >Dosage | >NDA | >Approval Date | >Patent No. | >Patent Expiration |
International Patents for acetaminophen
| Country | Patent Number | Estimated Expiration |
|---|---|---|
| Morocco | 26926 | Start Trial |
| Australia | 2010238854 | Start Trial |
| Hong Kong | 1166957 | Start Trial |
| European Patent Office | 2421522 | Start Trial |
| Canada | 2705733 | Start Trial |
| France | 2809619 | Start Trial |
| Spain | 2564547 | Start Trial |
| >Country | >Patent Number | >Estimated Expiration |
