DrugPatentWatch Database Preview
Diazepam - Generic Drug Details
What are the generic drug sources for diazepam and what is the scope of diazepam freedom to operate?
Diazepam
is the generic ingredient in eight branded drugs marketed by Roche, Lannett Co Inc, West-ward Pharms Int, Valeant Pharms North, Abraxis Pharm, Hospira, Marsam Pharms Llc, Parenta Pharms, Us Army, Warner Chilcott, Watson Labs, Watson Labs Inc, Pharmacia And Upjohn, Actavis Elizabeth, Barr, Dava Pharms Inc, Duramed Pharms Barr, Ferndale Labs, Halsey, Ivax Sub Teva Pharms, Martec Usa Llc, Mayne Pharma, Mylan, Pioneer Pharms, Roxane, Teva Pharms, Upsher-smith Labs, Vintage Pharms, Virtus Pharms, and Quantum Pharmics, and is included in eighty-two NDAs. Additional information is available in the individual branded drug profile pages.There are eight drug master file entries for diazepam. Forty-nine suppliers are listed for this compound.
Summary for diazepam
| US Patents: | 0 |
| Tradenames: | 8 |
| Applicants: | 30 |
| NDAs: | 82 |
| Drug Master File Entries: | 8 |
| Suppliers / Packagers: | 49 |
| Bulk Api Vendors: | 54 |
| Clinical Trials: | 84 |
| Patent Applications: | 6,366 |
| Formulation / Manufacturing: | see details |
| Drug Prices: | Drug price information for diazepam |
| Patent Litigation and PTAB cases: | See patent lawsuits and PTAB cases for diazepam |
| DailyMed Link: | diazepam at DailyMed |
Pharmacology for diazepam
| Ingredient-type | Benzodiazepines |
| Drug Class | Benzodiazepine Central alpha-2 Adrenergic Agonist |
| Mechanism of Action | Adrenergic alpha2-Agonists |
Medical Subject Heading (MeSH) Categories for diazepam
Synonyms for diazepam
| 1-Methyl-5-phenyl-7-chloro-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| 1-Methyl-5-phenyl-7-chloro-1,4-benzodiazepin-2-one |
| 11100-37-1 |
| 2-((2-Ethylhexyloxy)carbonyl)benzoic acid |
| 2H-1, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
| 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-1-methyl-5-phenyl- |
| 439-14-5 |
| 5-24-04-00300 (Beilstein Handbook Reference) |
| 53320-84-6 |
| 7 -chloro-1,3-dihydro-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one |
| 7-chloranyl-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| 7-chloro-1-methyl-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-one |
| 7-Chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepine |
| 7-Chloro-1-methyl-5-3H-1,4-benzodiazepin-2(1H)-one |
| 7-chloro-1-methyl-5-phenyl-1,3-dihydro-[1,4]benzodiazepin-2-one |
| 7-Chloro-1-methyl-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| 7-chloro-1-methyl-5-phenyl-1,3-dihydro-benzo[e][1,4]diazepin-2-one |
| 7-Chloro-1-methyl-5-phenyl-1,4-benzodiazepin-2-one |
| 7-chloro-1-methyl-5-phenyl-1H-1,4-benzodiazepine-2(3H)on |
| 7-Chloro-1-methyl-5-phenyl-1H-benzo[e][1,4]diazepin-2(3H)-one |
| 7-Chloro-1-methyl-5-phenyl-2-oxo-2,3-dihydro-1H-benzo[f]-1,4-diazepine |
| 7-chloro-1-methyl-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one |
| 7-Chloro-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one |
| 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| 7-Chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2(1H)-one |
| 7-chloro-1,3-dihydro-1-methyl-5-phenyl-2H -1,4-benzodiazepin-2-one |
| 7-Chloro-1,3-dihydro-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one |
| A3662/0155188 |
| A826456 |
| AAOVKJBEBIDNHE-UHFFFAOYSA-N |
| AB02310 |
| AC-10561 |
| AC1L1EZE |
| AK116444 |
| AKOS003367969 |
| Alboral |
| Aliseum |
| Alupram |
| Amiprol |
| AN-23449 |
| An-Ding |
| Anlin |
| Ansilive |
| Ansiolin |
| Ansiolisina |
| Antenex |
| Anxicalm |
| Anxionil |
| Apaurin |
| Apo-diazepam |
| Apozepam |
| Armonil |
| Arzepam |
| Assival |
| Atensine |
| Atilen |
| Azedipamin |
| Baogin |
| BCP0726000176 |
| BCP9000199 |
| BDBM50000766 |
| Bensedin |
| Benzopin |
| Best [Pharaceutical] |
| Betapam |
| Bialzepam |
| BIDD:GT0105 |
| BIDD:PXR0158 |
| BRD-K16508793-001-01-8 |
| Britazepam |
| BRN 0754371 |
| BSPBio_003279 |
| C-17931 |
| C06948 |
| Calmaven |
| Calmocitene |
| Calmociteno |
| Calmod |
| Calmpose |
| CAS-439-14-5 |
| Caudel |
| CC-26451 |
| CCG-100997 |
| CCRIS 6009 |
| Centrazepam |
| Cercine |
| Ceregulart |
| CHEBI:49575 |
| CHEMBL12 |
| Chuansuan |
| Condition |
| CPD000058398 |
| CS-0653 |
| D-Pam |
| D00293 |
| D07JVL |
| D0Y1YC |
| DB00829 |
| DEA No. 2765 |
| Desconet |
| Desloneg |
| Diacepan |
| Diaceplex |
| Dialag |
| Dialar |
| Diapam |
| Diapax |
| Diapine |
| Diaquel |
| Diastat |
| Diastat (TN) |
| Diastat Acudial |
| Diastat, Valium |
| Diatran |
| Diazapam |
| Diazem |
| Diazemuls |
| Diazemulus |
| Diazepam (intranasal, epilepsy) |
| Diazepam (JP17/USP/INN) |
| Diazepam [USAN:INN:BAN:JAN] |
| Diazepam 0.1 mg/ml in Methanol |
| Diazepam 1.0 mg/ml in Methanol |
| Diazepam Dak |
| Diazepam Desitin |
| Diazepam Elmu |
| Diazepam Fabra |
| Diazepam for system suitability, European Pharmacopoeia (EP) Reference Standard |
| Diazepam Intensol |
| Diazepam Nordic |
| Diazepam Rectubes |
| Diazepam solution, 1.0 mg/mL in methanol, ampule of 1 mL, certified reference material |
| Diazepam solution, 1.0 mg/mL in methanol, analytical standard, for drug analysis |
| Diazepam Stada |
| Diazepam-Eurogenerics |
| Diazepam-Lipuro |
| Diazepam-ratiopharm |
| Diazepam, European Pharmacopoeia (EP) Reference Standard |
| Diazepam, United States Pharmacopeia (USP) Reference Standard |
| Diazepamu |
| Diazepamu [Polish] |
| Diazepamum |
| Diazepamum [INN-Latin] |
| Diazepan |
| Diazepan leo |
| Diazepin |
| Diazetard |
| Dienpax |
| Dipam |
| Dipaz |
| Dipezona |
| Disopam |
| DivK1c_000967 |
| Dizac |
| Domalium |
| Doval |
| Drenian |
| DSSTox_CID_406 |
| DSSTox_GSID_20406 |
| DSSTox_RID_75566 |
| DTXSID4020406 |
| Ducene |
| Duksen |
| Dupin |
| Duxen |
| DZP |
| e-Pam |
| EINECS 207-122-5 |
| Elcion CR |
| Eridan |
| Euphorin P |
| Eurosan |
| Evacalm |
| Faustal |
| Faustan |
| Faustan, |
| Freudal |
| Frustan |
| FT-0632135 |
| Gewacalm |
| Gihitan |
| Gradual |
| GTPL3364 |
| Gubex |
| HE004298 |
| HE343443 |
| HE349411 |
| HMS2051N04 |
| HMS3393N04 |
| HMS503A15 |
| Horizon |
| HSDB 3057 |
| HY-17027 |
| I06-0194 |
| Iazepam |
| IDI1_000967 |
| InChI=1/C16H13ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h2-9H,10H2,1H |
| Jinpanfan |
| Kabivitrum |
| KBio1_000967 |
| KBio3_002780 |
| KBioGR_001012 |
| Kiatrium |
| Kratium |
| Kratium 2 |
| LA 111 |
| LA III |
| LA-111 |
| La-Iii |
| Lamra |
| Lembrol |
| Levium |
| Liberetas |
| Lizan |
| Lovium |
| LS-122 |
| Mandro |
| Mandro-Zep |
| Mandrozep |
| MCULE-8990989144 |
| Medipam |
| Mentalium |
| Metamidol |
| Methyl diazepinone |
| Methyldiazepinone |
| Methyldiazepinone (pharmaceutical) |
| Methyldiazepinone, pharmaceutical |
| Metil Gobanal |
| MLS000759402 |
| MLS001424086 |
| Mono (2-ethylhexyl) phthalate |
| Morosan |
| NC00247 |
| NCGC00178168-01 |
| NCGC00178168-02 |
| NCGC00178168-03 |
| NCGC00178168-04 |
| NCGC00260007-01 |
| Nellium |
| Nerozen |
| Nervium |
| neurolytr il |
| Neurolytril |
| NINDS_000967 |
| Nivalen |
| Nixtensyn |
| Noan |
| Notense |
| Novazam |
| Novo-Dipam |
| Novodipam |
| NSC 169897 |
| NSC-169897 |
| NSC-77518 |
| NSC169897 |
| NSC77518 |
| Oprea1_126223 |
| Ortopsique |
| Paceum |
| Pacitran |
| Paralium |
| Paranten |
| Parzam |
| Paxate |
| Paxel |
| Paxum |
| Placidox 10 |
| Placidox 2 |
| Placidox 5 |
| Plidan |
| Pms-Diazepam |
| Pomin |
| Pro pam |
| Prozepam |
| Psychopax |
| Q-pam |
| Q-Pam Relanium |
| Q3JTX2Q7TU |
| Quetinil |
| Quiatril |
| Quievita |
| Radizepam |
| Relaminal |
| Relanium |
| Reliver |
| Renborin |
| Ro 5-2805 |
| Ro 5-2807 |
| RO-5-2807 |
| Ro-52807 |
| Ruhsitus |
| S.A. R.L |
| S.a. r.l. |
| S.A.R.L. |
| SAM001246536 |
| Saromet |
| SCHEMBL21442 |
| Sedapam |
| Sedipam |
| Seduksen |
| Seduxen |
| Serenack |
| Serenamin |
| Serenzin |
| Servizepam |
| Setonil |
| Sibazon |
| Sibazone |
| Sico Relax |
| Simasedan |
| Sipam |
| SMR000058398 |
| Solis |
| Sonacon |
| Spectrum3_001780 |
| Spectrum4_000576 |
| Spectrum5_001890 |
| Stesolid |
| Stesolin |
| STK735517 |
| T-quil |
| Tensium |
| Tensopam |
| Tox21_113071 |
| Tox21_113071_1 |
| Tox21_202458 |
| Tranimul |
| Trankinon |
| Tranqdyn |
| Tranquase |
| Tranquirit |
| Tranquo-puren |
| Tranquo-tablinen |
| Trazepam |
| Umbrium |
| UNII-Q3JTX2Q7TU |
| Unisedil |
| Usempax ap |
| Valaxona |
| Valeo |
| Valiquid |
| Valitran |
| Valium |
| Valium (TN) |
| Valium R |
| Valrelease |
| Valuzepam |
| Vanconin |
| Vatran |
| Vazen |
| Vazepam |
| Velium |
| Vival |
| Vivol |
| W-5055 |
| Winii |
| WLN: T67 GNV JN IHJ CG G1 KR |
| Wy 3467 |
| WY-3467 |
| ZB000640 |
| Zepaxid |
| ZINC6427 |
| Zipan |
US Patents and Regulatory Information for diazepam
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Roxane | DIAZEPAM | diazepam | TABLET;ORAL | 070358-001 | Jun 17, 1986 | DISCN | No | No | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Quantum Pharmics | Q-PAM | diazepam | TABLET;ORAL | 072433-001 | Apr 29, 1988 | DISCN | No | No | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Roxane | DIAZEPAM | diazepam | TABLET;ORAL | 070357-001 | Jun 17, 1986 | DISCN | No | No | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
Expired US Patents for diazepam
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | Patent No. | Patent Expiration |
|---|---|---|---|---|---|---|---|
| Roche | VALIUM | diazepam | TABLET;ORAL | 013263-002 | Approved Prior to Jan 1, 1982 | ➤ Sign Up | ➤ Sign Up |
| Roche | VALIUM | diazepam | TABLET;ORAL | 013263-004 | Approved Prior to Jan 1, 1982 | ➤ Sign Up | ➤ Sign Up |
| Roche | VALRELEASE | diazepam | CAPSULE, EXTENDED RELEASE;ORAL | 018179-001 | Approved Prior to Jan 1, 1982 | ➤ Sign Up | ➤ Sign Up |
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | Patent No. | Patent Expiration |
For more information try a trial or see the plans and pricing
Serving hundreds of leading biopharmaceutical companies globally:
Drugs may be covered by multiple patents or regulatory protections. All trademarks and applicant names are the property of their respective owners or licensors. Although great care is taken in the proper and correct provision of this service, thinkBiotech LLC does not accept any responsibility for possible consequences of errors or omissions in the provided data. The data presented herein is for information purposes only. There is no warranty that the data contained herein is error free. thinkBiotech performs no independent verifification of facts as provided by public sources nor are attempts made to provide legal or investing advice. Any reliance on data provided herein is done solely at the discretion of the user. Users of this service are advised to seek professional advice and independent confirmation before considering acting on any of the provided information. thinkBiotech LLC reserves the right to amend, extend or withdraw any part or all of the offered service without notice.
Copyright 2002-2018 thinkBiotech LLC
ISSN: 2162-2639
Privacy and Cookies
Terms & Conditions
Site Map
Major Patent Expirations 2018 - 2019
ISSN: 2162-2639
Privacy and Cookies
Terms & Conditions
Site Map
Major Patent Expirations 2018 - 2019
Preferred Citation:
Friedman, Yali. "DrugPatentWatch" DrugPatentWatch, thinkBiotech, 2018, www.DrugPatentWatch.com.
Friedman, Yali. "DrugPatentWatch" DrugPatentWatch, thinkBiotech, 2018, www.DrugPatentWatch.com.
Follow DrugPatentWatch: