DrugPatentWatch Database Preview
FLUOROURACIL Drug Profile
or, see our see our flat-rate plans
Which patents cover Fluorouracil, and what generic alternatives are available?
The generic ingredient in FLUOROURACIL is fluorouracil. There are fifteen drug master file entries for this compound. Nineteen suppliers are listed for this compound. Additional details are available on the fluorouracil profile page.
Summary for FLUOROURACIL
| US Patents: | 0 |
| Applicants: | 18 |
| NDAs: | 31 |
| Suppliers / Packagers: | 12 |
| Bulk Api Vendors: | 143 |
| Clinical Trials: | 1,364 |
| Patent Applications: | 193 |
| Formulation / Manufacturing: | see details |
| Patent Litigation and PTAB cases: | See patent lawsuits and PTAB cases for FLUOROURACIL |
| DailyMed Link: | FLUOROURACIL at DailyMed |
Pharmacology for FLUOROURACIL
| Drug Class | Nucleoside Metabolic Inhibitor |
| Mechanism of Action | Nucleic Acid Synthesis Inhibitors |
Medical Subject Heading (MeSH) Categories for FLUOROURACIL
Synonyms for FLUOROURACIL
| (5-fluorouracil)5-Fluoro-1H-pyrimidine-2,4-dione |
| 1-fluoro-1h-pyrimidine-2,4-dione |
| 1004-03-1 |
| 191047-64-0 |
| 191047-65-1 |
| 191115-88-5 |
| 1upf |
| 2,3H)-Pyrimidinedione, 5-fluoro- |
| 2,4-Dihydroxy-5-fluoropyrimidine |
| 2,4-Dihydroxy-5-fluoropyrimidine; 5-Fluoro-2,4(1H,3H)-pyrimidinedione; 5-FU |
| 2,4-Dioxo-5-fluoropryimidine |
| 2,4-Dioxo-5-fluoropyrimidine |
| 2,4-Pyrimidinediol, 5-fluoro- (9CI) |
| 2,4-Pyrimidinedione, 5-fluoro- |
| 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
| 2(1H)-Pyrimidinone, 5-fluoro-4-hydroxy- (9CI) |
| 29507-EP2270008A1 |
| 29507-EP2270505A1 |
| 29507-EP2272827A1 |
| 29507-EP2289892A1 |
| 29507-EP2292234A1 |
| 29507-EP2292617A1 |
| 29507-EP2295426A1 |
| 29507-EP2295427A1 |
| 29507-EP2298305A1 |
| 29507-EP2308861A1 |
| 29507-EP2311842A2 |
| 4(3H)-Pyrimidinone, 5-fluoro-2-hydroxy- (9CI) |
| 42164-EP2272827A1 |
| 42164-EP2275420A1 |
| 42164-EP2277565A2 |
| 42164-EP2277566A2 |
| 42164-EP2277567A1 |
| 42164-EP2277568A2 |
| 42164-EP2277569A2 |
| 42164-EP2277570A2 |
| 42164-EP2277876A1 |
| 42164-EP2292280A1 |
| 42164-EP2292614A1 |
| 42164-EP2295412A1 |
| 42164-EP2295413A1 |
| 42164-EP2295416A2 |
| 42164-EP2298748A2 |
| 42164-EP2298764A1 |
| 42164-EP2298765A1 |
| 42164-EP2298778A1 |
| 42164-EP2305642A2 |
| 42164-EP2308833A2 |
| 42164-EP2311808A1 |
| 42164-EP2311829A1 |
| 42164-EP2311840A1 |
| 4921-97-5 |
| 4CA-0544 |
| 5 Fluorouracil |
| 5 Fluorouracil biosyn |
| 5 FU Lederle |
| 5 FU medac |
| 5 HU Hexal |
| 5-?FLUORO-?2,?4(1H,?3H)-?PYRIMIDINEDIONE |
| 5-Faracil |
| 5-florouracil |
| 5-Fluor-2,4-dihydroxypyrimidin |
| 5-Fluor-2,4-dihydroxypyrimidin [Czech] |
| 5-Fluor-2,4-pyrimidindiol |
| 5-Fluor-2,4-pyrimidindiol [Czech] |
| 5-Fluor-2,4(1H,3H)-pyrimidindion |
| 5-Fluor-2,4(1H,3H)-pyrimidindion [Czech] |
| 5-Fluoracil |
| 5-Fluoracil [German] |
| 5-Fluoracyl |
| 5-fluoro uracil |
| 5-fluoro-1,2,3,4-tetrahydropyrimidine-2,4-dione |
| 5-fluoro-1,3-dihydropyrimidine-2,4-dione |
| 5-fluoro-1H-pyrimidine-2,4-dione |
| 5-Fluoro-1H-pyrimidine-2,4-dione (5-Fluorouracil) |
| 5-Fluoro-1H-pyrimidine-2,4-dione (5-FU) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-fluoro uracil) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-fluorouracil)(5-FU) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-FU) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-FUra) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5FU) |
| 5-Fluoro-2,3H)-pyrimidinedione |
| 5-Fluoro-2,4-(1H,3H)-pyrimidinedione |
| 5-fluoro-2,4-dioxo-pyrimidin |
| 5-fluoro-2,4-Pyrimidinediol |
| 5-Fluoro-2,4-pyrimidinedione |
| 5-Fluoro-2,4(1H,3H)-pyrimidinedione |
| 5-fluoro-pyrimidine-2,4-diol |
| 5-fluoro-uracil |
| 5-Fluoropyrimidin-2,4-diol |
| 5-fluoropyrimidine-2,4-diol |
| 5-Fluoropyrimidine-2,4-dione |
| 5-fluoropyrimidine-2,4(1H,3H)-dione |
| 5-fluorouacil |
| 5-Fluorouracil |
| 5-Fluorouracil-biosyn |
| 5-FLUOROURACIL, [2-14C]- 50-60 MCI(1.85-2.22 GBQ)/MMOL, HPLC PURIFIED, 98% PURE WITH HPLC RADIOCHROMATOGRAM |
| 5-Fluorouracil, >=99% (HPLC), powder |
| 5-Fluorouracil, 99% |
| 5-Fluorouracil, 99% 5g |
| 5-Fluorouracil, analytical standard |
| 5-Fluorouracil, certified reference material, TraceCERT(R) |
| 5-Fluorouracil, Vetec(TM) reagent grade, >=99% |
| 5-fluorourasil |
| 5-fluorpyrimidin-2,4-diol |
| 5-Fluoruracil |
| 5-Fluoruracil [German] |
| 5-Fluracil |
| 5-Ftouracyl |
| 5-FU |
| 5-FU (TN) |
| 5-FU Lederle |
| 5-FU medac |
| 5-HU Hexal |
| 51-21-8 |
| 51F218 |
| 5F-uracil |
| 5FU |
| 7375-EP2269989A1 |
| 7375-EP2269994A1 |
| 7375-EP2270008A1 |
| 7375-EP2270018A1 |
| 7375-EP2272827A1 |
| 7375-EP2272832A1 |
| 7375-EP2275102A1 |
| 7375-EP2275412A1 |
| 7375-EP2275413A1 |
| 7375-EP2277876A1 |
| 7375-EP2280012A2 |
| 7375-EP2281563A1 |
| 7375-EP2281815A1 |
| 7375-EP2287156A1 |
| 7375-EP2289892A1 |
| 7375-EP2292233A2 |
| 7375-EP2292614A1 |
| 7375-EP2292615A1 |
| 7375-EP2292617A1 |
| 7375-EP2295416A2 |
| 7375-EP2295426A1 |
| 7375-EP2295427A1 |
| 7375-EP2298748A2 |
| 7375-EP2298768A1 |
| 7375-EP2298772A1 |
| 7375-EP2298780A1 |
| 7375-EP2301928A1 |
| 7375-EP2301933A1 |
| 7375-EP2305219A1 |
| 7375-EP2305243A1 |
| 7375-EP2305640A2 |
| 7375-EP2305642A2 |
| 7375-EP2305671A1 |
| 7375-EP2305689A1 |
| 7375-EP2308833A2 |
| 7375-EP2308839A1 |
| 7375-EP2308855A1 |
| 7375-EP2308861A1 |
| 7375-EP2311807A1 |
| 7375-EP2311808A1 |
| 7375-EP2311825A1 |
| 7375-EP2311827A1 |
| 7375-EP2311829A1 |
| 7375-EP2311840A1 |
| 7375-EP2314590A1 |
| 7375-EP2316459A1 |
| 7375-EP2316831A1 |
| 7375-EP2316834A1 |
| 7375-EP2316974A1 |
| 7375-EP2374454A1 |
| 79108-01-3 |
| AB1000177 |
| AC-11201 |
| AC1L1FTE |
| AC1Q4N2X |
| ACMC-1ATRK |
| Adrucil |
| Adrucil (Fluorouracil) |
| Adrucil (ICN) |
| Adrucil (TN) |
| AI3-25297 |
| AJ-94651 |
| AK-46307 |
| AKOS000119162 |
| AKOS003237897 |
| AKOS008044307 |
| AKOS022965835 |
| Allergan Brand of Fluorouracil |
| AM20100252 |
| AN-7240 |
| ANW-31214 |
| Arumel |
| BB_NC-0576 |
| BBL009635 |
| BC227022 |
| BCP9000239 |
| BCPP000428 |
| BDBM50340677 |
| biosyn Brand of Fluorouracil |
| BSPBio_002048 |
| C07649 |
| C4H3FN2O2 |
| Cantide + 5-FU |
| Carac |
| Carac (TN) |
| Carzonal |
| CAS-51-21-8 |
| CCG-39879 |
| CCRIS 2582 |
| CF0033 |
| CHEBI:46345 |
| CHEMBL185 |
| Cinco FU |
| CPD000038082 |
| CS-0993 |
| CSP Brand of Fluorouracil |
| CTK1H0569 |
| CTK8H4220 |
| D00584 |
| D05LEO |
| D08EPN |
| D0A7VK |
| D0K7CG |
| Dakota Brand of Fluorouracil |
| Dakota, Fluorouracile |
| DB-051923 |
| DB-065735 |
| DB00544 |
| Dermatech Brand of Fluorouracil |
| Dermik Brandof Fluorouracil |
| DivK1c_000054 |
| DL-399 |
| DSSTox_CID_634 |
| DSSTox_GSID_20634 |
| DSSTox_RID_75705 |
| DTXSID2020634 |
| EC 200-085-6 |
| Effluderm |
| Effluderm (free base) |
| Efudex |
| Efudex (TN) |
| Efudix |
| Efurix |
| EINECS 200-085-6 |
| EU-0100536 |
| F 6627 |
| F0151 |
| Ferrer Brand of Fluorouracil |
| Fluoro Uracil |
| Fluoro Uracile ICN |
| Fluoro-uracile |
| Fluoro-Uracile ICN |
| Fluoro-uracilo |
| Fluoroblastin |
| Fluoroplex |
| Fluoroplex (TN) |
| Fluorouracil - Adrucil |
| Fluorouracil (Adrucil) |
| Fluorouracil (JP15/USP/INN) |
| Fluorouracil (JP17/USP/INN) |
| Fluorouracil [USAN:INN:BAN:JAN] |
| Fluorouracil [USAN:USP:INN:BAN:JAN] |
| Fluorouracil Cream |
| Fluorouracil GRY |
| Fluorouracil Mononitrate |
| Fluorouracil Monopotassium Salt |
| Fluorouracil Monosodium Salt |
| Fluorouracil Potassium Salt |
| Fluorouracil Teva Brand |
| Fluorouracil-GRY |
| Fluorouracil, 5- |
| Fluorouracil, European Pharmacopoeia (EP) Reference Standard |
| Fluorouracil, meets USP testing specifications |
| Fluorouracil, pharmaceutical secondary standard; traceable to USP, PhEur and BP |
| Fluorouracil, United States Pharmacopeia (USP) Reference Standard |
| Fluorouracile |
| Fluorouracile [DCIT] |
| Fluorouracile Dakota |
| Fluorouracilo |
| Fluorouracilo [INN-Spanish] |
| Fluorouracilo Ferrer Far |
| Fluorouracilum |
| Fluorouracilum [INN-Latin] |
| Fluoruracil |
| Fluouracil |
| Fluracedyl |
| Fluracil |
| Fluracilum |
| Fluri |
| Fluril |
| Fluro Uracil |
| Fluroblastin |
| Flurodex |
| FT-0082524 |
| FT-0601511 |
| FT-0707652 |
| Ftoruracil |
| FU |
| GHASVSINZRGABV-UHFFFAOYSA-N |
| Gry Brand of Fluorouracil |
| GTPL4789 |
| Haemato Brand of Fluorouracil |
| Haemato fu |
| Haemato-fu |
| HE000534 |
| HE238817 |
| HE238818 |
| HE238819 |
| Hexal Brand of Fluorouracil |
| HMS1920O18 |
| HMS2090I04 |
| HMS2091F19 |
| HMS3259O03 |
| HMS3261L13 |
| HMS3654K22 |
| HMS500C16 |
| HSDB 3228 |
| HY-90006 |
| I07-0022 |
| ICN Brand of Fluorouracil |
| IDI1_000054 |
| IN1335 |
| InChI=1/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9 |
| inhibits thymilidate synthetase |
| KBio1_000054 |
| KBio2_001321 |
| KBio2_003889 |
| KBio2_006457 |
| KBio3_001268 |
| KBioGR_001253 |
| KBioSS_001321 |
| Kecimeton |
| KS-00000DY3 |
| KS-5129 |
| KSC270K6T |
| Lopac-F-6627 |
| Lopac0_000536 |
| LP00536 |
| LS-153 |
| LS40596 |
| MCULE-6338086431 |
| medac Brand of Fluorouracil |
| MFCD00006018 |
| MLS000069498 |
| MLS002415705 |
| MolPort-000-156-102 |
| MolPort-003-990-447 |
| NC00454 |
| NCGC00015442-01 |
| NCGC00015442-02 |
| NCGC00015442-03 |
| NCGC00015442-04 |
| NCGC00015442-05 |
| NCGC00015442-06 |
| NCGC00015442-07 |
| NCGC00015442-08 |
| NCGC00015442-09 |
| NCGC00015442-10 |
| NCGC00015442-11 |
| NCGC00015442-12 |
| NCGC00015442-15 |
| NCGC00015442-16 |
| NCGC00091349-01 |
| NCGC00091349-02 |
| NCGC00091349-03 |
| NCGC00091349-04 |
| NCGC00091349-05 |
| NCGC00091349-07 |
| NCGC00091349-08 |
| NCGC00254023-01 |
| NCGC00259884-01 |
| NCGC00261221-01 |
| NCI60_001652 |
| Neocorp Brand of Fluorouracil |
| Neofluor |
| NINDS_000054 |
| NSC 19893 |
| NSC-19893 |
| NSC-757036 |
| NSC19893 |
| NSC757036 |
| Onkofluor |
| Onkoworks Brand of Fluorouracil |
| Opera_ID_134 |
| Pharmakon1600-01500305 |
| Phthoruracil |
| Phtoruracil |
| pyrimidine antimetabolite: inhibits nucleic acid replication; tetratogen |
| Queroplex |
| Ribofluor |
| ribosepharm Brand of Fluorouracil |
| Riemser Brand of Fluorouracil |
| Ro 2-9757 |
| Ro-2-9757 |
| Ro-29757 |
| Roche Brand of Fluorouracil |
| RP19888 |
| RW2456 |
| s1209 |
| SAM002264615 |
| SBB085751 |
| SBI-0050519.P004 |
| SC-09038 |
| SCHEMBL3646 |
| SMR000038082 |
| SPBio_000291 |
| Spectrum_000841 |
| SPECTRUM1500305 |
| Spectrum2_000076 |
| Spectrum3_000434 |
| Spectrum4_000557 |
| Spectrum5_000718 |
| SR-01000075881 |
| SR-01000075881-1 |
| SRI-10792_07 |
| SRI-10792_08 |
| SRI-10792-04 |
| SRI-10792-05 |
| SRI-10792-06 |
| ST45025877 |
| STK297802 |
| STL367375 |
| T5233394 |
| tetratogen |
| Teva Brand of Fluorouracil |
| Timazin |
| TL8006093 |
| Tolak |
| Tox21_110150 |
| Tox21_110150_1 |
| Tox21_202335 |
| Tox21_300112 |
| Tox21_500536 |
| TS antisense + 5-FU |
| U 8953 |
| U-8953 |
| U3P01618RT |
| Ulup |
| UNII-U3P01618RT |
| UPCMLD-DP130 |
| UPCMLD-DP130:001 |
| Uracil, 5-fluoro- |
| URF |
| W-202929 |
| W-5036 |
| W-60379 |
| WLN: T6MVMVJ EF |
| Z275128052 |
| ZINC38212689 |
US Patents and Regulatory Information for FLUOROURACIL
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Teva Pharms Usa | FLUOROURACIL | fluorouracil | INJECTABLE;INJECTION | 040334-001 | Feb 25, 2000 | AP | RX | No | Yes | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | |||
| Sagent Pharms | FLUOROURACIL | fluorouracil | INJECTABLE;INJECTION | 203608-001 | May 11, 2017 | AP | RX | No | No | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | |||
| Taro Pharm | FLUOROURACIL | fluorouracil | SOLUTION;TOPICAL | 076526-002 | Nov 5, 2003 | AT | RX | No | No | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | |||
| Mylan Labs Ltd | FLUOROURACIL | fluorouracil | INJECTABLE;INJECTION | 202668-001 | Jul 17, 2012 | AP | RX | No | No | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | |||
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
or, see our see our flat-rate plans
or, see our see our flat-rate plans
