DrugPatentWatch Database Preview
FLUOROURACIL Drug Profile
see a sample report or, see our see our flat-rate plans
Which patents cover Fluorouracil, and what generic alternatives are available?
Fluorouracil is a drug marketed by Mayne Pharma, Mylan Pharms Inc, Taro, Abic, Abraxis Pharm, Accord Hlthcare, Bedford, Ebewe Pharma, Fresenius Kabi Usa, Gland Pharma Ltd, Marchar, Mylan Labs Ltd, Sagent Pharms, Sandoz, Smith And Nephew, Spectrum Pharms, Teva Pharms Usa, and Taro Pharm. and is included in thirty-one NDAs.
The generic ingredient in FLUOROURACIL is fluorouracil. There are fifteen drug master file entries for this compound. Eighteen suppliers are listed for this compound. Additional details are available on the fluorouracil profile page.
Summary for FLUOROURACIL
Pharmacology for FLUOROURACIL
| Drug Class | Nucleoside Metabolic Inhibitor |
| Mechanism of Action | Nucleic Acid Synthesis Inhibitors |
Medical Subject Heading (MeSH) Categories for FLUOROURACIL
Synonyms for FLUOROURACIL
| (5-fluorouracil)5-Fluoro-1H-pyrimidine-2,4-dione |
| 1-fluoro-1h-pyrimidine-2,4-dione |
| 1004-03-1 |
| 191047-64-0 |
| 191047-65-1 |
| 191115-88-5 |
| 1upf |
| 2,3H)-Pyrimidinedione, 5-fluoro- |
| 2,4-Dihydroxy-5-fluoropyrimidine |
| 2,4-Dihydroxy-5-fluoropyrimidine; 5-Fluoro-2,4(1H,3H)-pyrimidinedione; 5-FU |
| 2,4-Dioxo-5-fluoropryimidine |
| 2,4-Dioxo-5-fluoropyrimidine |
| 2,4-Pyrimidinediol, 5-fluoro- (9CI) |
| 2,4-Pyrimidinedione, 5-fluoro- |
| 2,4(1H,3H)-Pyrimidinedione, 5-fluoro- |
| 2(1H)-Pyrimidinone, 5-fluoro-4-hydroxy- (9CI) |
| 29507-EP2270008A1 |
| 29507-EP2270505A1 |
| 29507-EP2272827A1 |
| 29507-EP2289892A1 |
| 29507-EP2292234A1 |
| 29507-EP2292617A1 |
| 29507-EP2295426A1 |
| 29507-EP2295427A1 |
| 29507-EP2298305A1 |
| 29507-EP2308861A1 |
| 29507-EP2311842A2 |
| 4(3H)-Pyrimidinone, 5-fluoro-2-hydroxy- (9CI) |
| 42164-EP2272827A1 |
| 42164-EP2275420A1 |
| 42164-EP2277565A2 |
| 42164-EP2277566A2 |
| 42164-EP2277567A1 |
| 42164-EP2277568A2 |
| 42164-EP2277569A2 |
| 42164-EP2277570A2 |
| 42164-EP2277876A1 |
| 42164-EP2292280A1 |
| 42164-EP2292614A1 |
| 42164-EP2295412A1 |
| 42164-EP2295413A1 |
| 42164-EP2295416A2 |
| 42164-EP2298748A2 |
| 42164-EP2298764A1 |
| 42164-EP2298765A1 |
| 42164-EP2298778A1 |
| 42164-EP2305642A2 |
| 42164-EP2308833A2 |
| 42164-EP2311808A1 |
| 42164-EP2311829A1 |
| 42164-EP2311840A1 |
| 4921-97-5 |
| 4CA-0544 |
| 5 Fluorouracil |
| 5 Fluorouracil biosyn |
| 5 FU Lederle |
| 5 FU medac |
| 5 HU Hexal |
| 5-?FLUORO-?2,?4(1H,?3H)-?PYRIMIDINEDIONE |
| 5-Faracil |
| 5-florouracil |
| 5-Fluor-2,4-dihydroxypyrimidin |
| 5-Fluor-2,4-dihydroxypyrimidin [Czech] |
| 5-Fluor-2,4-pyrimidindiol |
| 5-Fluor-2,4-pyrimidindiol [Czech] |
| 5-Fluor-2,4(1H,3H)-pyrimidindion |
| 5-Fluor-2,4(1H,3H)-pyrimidindion [Czech] |
| 5-Fluoracil |
| 5-Fluoracil [German] |
| 5-Fluoracyl |
| 5-fluoro uracil |
| 5-fluoro-1,2,3,4-tetrahydropyrimidine-2,4-dione |
| 5-fluoro-1,3-dihydropyrimidine-2,4-dione |
| 5-fluoro-1H-pyrimidine-2,4-dione |
| 5-Fluoro-1H-pyrimidine-2,4-dione (5-Fluorouracil) |
| 5-Fluoro-1H-pyrimidine-2,4-dione (5-FU) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-fluoro uracil) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-fluorouracil)(5-FU) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-FU) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5-FUra) |
| 5-Fluoro-1H-pyrimidine-2,4-dione(5FU) |
| 5-Fluoro-2,3H)-pyrimidinedione |
| 5-Fluoro-2,4-(1H,3H)-pyrimidinedione |
| 5-fluoro-2,4-dioxo-pyrimidin |
| 5-fluoro-2,4-Pyrimidinediol |
| 5-Fluoro-2,4-pyrimidinedione |
| 5-Fluoro-2,4(1H,3H)-pyrimidinedione |
| 5-fluoro-pyrimidine-2,4-diol |
| 5-fluoro-uracil |
| 5-Fluoropyrimidin-2,4-diol |
| 5-fluoropyrimidine-2,4-diol |
| 5-Fluoropyrimidine-2,4-dione |
| 5-fluoropyrimidine-2,4(1H,3H)-dione |
| 5-fluorouacil |
| 5-Fluorouracil |
| 5-Fluorouracil-biosyn |
| 5-FLUOROURACIL, [2-14C]- 50-60 MCI(1.85-2.22 GBQ)/MMOL, HPLC PURIFIED, 98% PURE WITH HPLC RADIOCHROMATOGRAM |
| 5-Fluorouracil, >=99% (HPLC), powder |
| 5-Fluorouracil, 99% |
| 5-Fluorouracil, 99% 5g |
| 5-Fluorouracil, analytical standard |
| 5-Fluorouracil, certified reference material, TraceCERT(R) |
| 5-Fluorouracil, Vetec(TM) reagent grade, >=99% |
| 5-fluorourasil |
| 5-fluorpyrimidin-2,4-diol |
| 5-Fluoruracil |
| 5-Fluoruracil [German] |
| 5-Fluracil |
| 5-Ftouracyl |
| 5-FU |
| 5-FU (TN) |
| 5-FU Lederle |
| 5-FU medac |
| 5-HU Hexal |
| 51-21-8 |
| 51F218 |
| 5F-uracil |
| 5FU |
| 7375-EP2269989A1 |
| 7375-EP2269994A1 |
| 7375-EP2270008A1 |
| 7375-EP2270018A1 |
| 7375-EP2272827A1 |
| 7375-EP2272832A1 |
| 7375-EP2275102A1 |
| 7375-EP2275412A1 |
| 7375-EP2275413A1 |
| 7375-EP2277876A1 |
| 7375-EP2280012A2 |
| 7375-EP2281563A1 |
| 7375-EP2281815A1 |
| 7375-EP2287156A1 |
| 7375-EP2289892A1 |
| 7375-EP2292233A2 |
| 7375-EP2292614A1 |
| 7375-EP2292615A1 |
| 7375-EP2292617A1 |
| 7375-EP2295416A2 |
| 7375-EP2295426A1 |
| 7375-EP2295427A1 |
| 7375-EP2298748A2 |
| 7375-EP2298768A1 |
| 7375-EP2298772A1 |
| 7375-EP2298780A1 |
| 7375-EP2301928A1 |
| 7375-EP2301933A1 |
| 7375-EP2305219A1 |
| 7375-EP2305243A1 |
| 7375-EP2305640A2 |
| 7375-EP2305642A2 |
| 7375-EP2305671A1 |
| 7375-EP2305689A1 |
| 7375-EP2308833A2 |
| 7375-EP2308839A1 |
| 7375-EP2308855A1 |
| 7375-EP2308861A1 |
| 7375-EP2311807A1 |
| 7375-EP2311808A1 |
| 7375-EP2311825A1 |
| 7375-EP2311827A1 |
| 7375-EP2311829A1 |
| 7375-EP2311840A1 |
| 7375-EP2314590A1 |
| 7375-EP2316459A1 |
| 7375-EP2316831A1 |
| 7375-EP2316834A1 |
| 7375-EP2316974A1 |
| 7375-EP2374454A1 |
| 79108-01-3 |
| AB1000177 |
| AC-11201 |
| AC1L1FTE |
| AC1Q4N2X |
| ACMC-1ATRK |
| Adrucil |
| Adrucil (Fluorouracil) |
| Adrucil (ICN) |
| Adrucil (TN) |
| AI3-25297 |
| AJ-94651 |
| AK-46307 |
| AKOS000119162 |
| AKOS003237897 |
| AKOS008044307 |
| AKOS022965835 |
| Allergan Brand of Fluorouracil |
| AM20100252 |
| AN-7240 |
| ANW-31214 |
| Arumel |
| BB_NC-0576 |
| BBL009635 |
| BC227022 |
| BCP9000239 |
| BCPP000428 |
| BDBM50340677 |
| biosyn Brand of Fluorouracil |
| BSPBio_002048 |
| C07649 |
| C4H3FN2O2 |
| Cantide + 5-FU |
| Carac |
| Carac (TN) |
| Carzonal |
| CAS-51-21-8 |
| CCG-39879 |
| CCRIS 2582 |
| CF0033 |
| CHEBI:46345 |
| CHEMBL185 |
| Cinco FU |
| CPD000038082 |
| CS-0993 |
| CSP Brand of Fluorouracil |
| CTK1H0569 |
| CTK8H4220 |
| D00584 |
| D05LEO |
| D08EPN |
| D0A7VK |
| D0K7CG |
| Dakota Brand of Fluorouracil |
| Dakota, Fluorouracile |
| DB-051923 |
| DB-065735 |
| DB00544 |
| Dermatech Brand of Fluorouracil |
| Dermik Brandof Fluorouracil |
| DivK1c_000054 |
| DL-399 |
| DSSTox_CID_634 |
| DSSTox_GSID_20634 |
| DSSTox_RID_75705 |
| DTXSID2020634 |
| EC 200-085-6 |
| Effluderm |
| Effluderm (free base) |
| Efudex |
| Efudex (TN) |
| Efudix |
| Efurix |
| EINECS 200-085-6 |
| EU-0100536 |
| F 6627 |
| F0151 |
| Ferrer Brand of Fluorouracil |
| Fluoro Uracil |
| Fluoro Uracile ICN |
| Fluoro-uracile |
| Fluoro-Uracile ICN |
| Fluoro-uracilo |
| Fluoroblastin |
| Fluoroplex |
| Fluoroplex (TN) |
| Fluorouracil - Adrucil |
| Fluorouracil (Adrucil) |
| Fluorouracil (JP15/USP/INN) |
| Fluorouracil (JP17/USP/INN) |
| Fluorouracil [USAN:INN:BAN:JAN] |
| Fluorouracil [USAN:USP:INN:BAN:JAN] |
| Fluorouracil Cream |
| Fluorouracil GRY |
| Fluorouracil Mononitrate |
| Fluorouracil Monopotassium Salt |
| Fluorouracil Monosodium Salt |
| Fluorouracil Potassium Salt |
| Fluorouracil Teva Brand |
| Fluorouracil-GRY |
| Fluorouracil, 5- |
| Fluorouracil, European Pharmacopoeia (EP) Reference Standard |
| Fluorouracil, meets USP testing specifications |
| Fluorouracil, pharmaceutical secondary standard; traceable to USP, PhEur and BP |
| Fluorouracil, United States Pharmacopeia (USP) Reference Standard |
| Fluorouracile |
| Fluorouracile [DCIT] |
| Fluorouracile Dakota |
| Fluorouracilo |
| Fluorouracilo [INN-Spanish] |
| Fluorouracilo Ferrer Far |
| Fluorouracilum |
| Fluorouracilum [INN-Latin] |
| Fluoruracil |
| Fluouracil |
| Fluracedyl |
| Fluracil |
| Fluracilum |
| Fluri |
| Fluril |
| Fluro Uracil |
| Fluroblastin |
| Flurodex |
| FT-0082524 |
| FT-0601511 |
| FT-0707652 |
| Ftoruracil |
| FU |
| GHASVSINZRGABV-UHFFFAOYSA-N |
| Gry Brand of Fluorouracil |
| GTPL4789 |
| Haemato Brand of Fluorouracil |
| Haemato fu |
| Haemato-fu |
| HE000534 |
| HE238817 |
| HE238818 |
| HE238819 |
| Hexal Brand of Fluorouracil |
| HMS1920O18 |
| HMS2090I04 |
| HMS2091F19 |
| HMS3259O03 |
| HMS3261L13 |
| HMS3654K22 |
| HMS500C16 |
| HSDB 3228 |
| HY-90006 |
| I07-0022 |
| ICN Brand of Fluorouracil |
| IDI1_000054 |
| IN1335 |
| InChI=1/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9 |
| inhibits thymilidate synthetase |
| KBio1_000054 |
| KBio2_001321 |
| KBio2_003889 |
| KBio2_006457 |
| KBio3_001268 |
| KBioGR_001253 |
| KBioSS_001321 |
| Kecimeton |
| KS-00000DY3 |
| KS-5129 |
| KSC270K6T |
| Lopac-F-6627 |
| Lopac0_000536 |
| LP00536 |
| LS-153 |
| LS40596 |
| MCULE-6338086431 |
| medac Brand of Fluorouracil |
| MFCD00006018 |
| MLS000069498 |
| MLS002415705 |
| MolPort-000-156-102 |
| MolPort-003-990-447 |
| NC00454 |
| NCGC00015442-01 |
| NCGC00015442-02 |
| NCGC00015442-03 |
| NCGC00015442-04 |
| NCGC00015442-05 |
| NCGC00015442-06 |
| NCGC00015442-07 |
| NCGC00015442-08 |
| NCGC00015442-09 |
| NCGC00015442-10 |
| NCGC00015442-11 |
| NCGC00015442-12 |
| NCGC00015442-15 |
| NCGC00015442-16 |
| NCGC00091349-01 |
| NCGC00091349-02 |
| NCGC00091349-03 |
| NCGC00091349-04 |
| NCGC00091349-05 |
| NCGC00091349-07 |
| NCGC00091349-08 |
| NCGC00254023-01 |
| NCGC00259884-01 |
| NCGC00261221-01 |
| NCI60_001652 |
| Neocorp Brand of Fluorouracil |
| Neofluor |
| NINDS_000054 |
| NSC 19893 |
| NSC-19893 |
| NSC-757036 |
| NSC19893 |
| NSC757036 |
| Onkofluor |
| Onkoworks Brand of Fluorouracil |
| Opera_ID_134 |
| Pharmakon1600-01500305 |
| Phthoruracil |
| Phtoruracil |
| pyrimidine antimetabolite: inhibits nucleic acid replication; tetratogen |
| Queroplex |
| Ribofluor |
| ribosepharm Brand of Fluorouracil |
| Riemser Brand of Fluorouracil |
| Ro 2-9757 |
| Ro-2-9757 |
| Ro-29757 |
| Roche Brand of Fluorouracil |
| RP19888 |
| RW2456 |
| s1209 |
| SAM002264615 |
| SBB085751 |
| SBI-0050519.P004 |
| SC-09038 |
| SCHEMBL3646 |
| SMR000038082 |
| SPBio_000291 |
| Spectrum_000841 |
| SPECTRUM1500305 |
| Spectrum2_000076 |
| Spectrum3_000434 |
| Spectrum4_000557 |
| Spectrum5_000718 |
| SR-01000075881 |
| SR-01000075881-1 |
| SRI-10792_07 |
| SRI-10792_08 |
| SRI-10792-04 |
| SRI-10792-05 |
| SRI-10792-06 |
| ST45025877 |
| STK297802 |
| STL367375 |
| T5233394 |
| tetratogen |
| Teva Brand of Fluorouracil |
| Timazin |
| TL8006093 |
| Tolak |
| Tox21_110150 |
| Tox21_110150_1 |
| Tox21_202335 |
| Tox21_300112 |
| Tox21_500536 |
| TS antisense + 5-FU |
| U 8953 |
| U-8953 |
| U3P01618RT |
| Ulup |
| UNII-U3P01618RT |
| UPCMLD-DP130 |
| UPCMLD-DP130:001 |
| Uracil, 5-fluoro- |
| URF |
| W-202929 |
| W-5036 |
| W-60379 |
| WLN: T6MVMVJ EF |
| Z275128052 |
| ZINC38212689 |
US Patents and Regulatory Information for FLUOROURACIL
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Teva Pharms Usa | FLUOROURACIL | fluorouracil | INJECTABLE;INJECTION | 040334-001 | Feb 25, 2000 | AP | RX | No | Yes | ➤ Try a Free Trial | ➤ Try a Free Trial | ➤ Try a Free Trial | |||
| Sagent Pharms | FLUOROURACIL | fluorouracil | INJECTABLE;INJECTION | 203608-001 | May 11, 2017 | AP | RX | No | No | ➤ Try a Free Trial | ➤ Try a Free Trial | ➤ Try a Free Trial | |||
| Taro Pharm | FLUOROURACIL | fluorouracil | SOLUTION;TOPICAL | 076526-002 | Nov 5, 2003 | AT | RX | No | No | ➤ Try a Free Trial | ➤ Try a Free Trial | ➤ Try a Free Trial | |||
| Mylan Labs Ltd | FLUOROURACIL | fluorouracil | INJECTABLE;INJECTION | 202668-001 | Jul 17, 2012 | AP | RX | No | No | ➤ Try a Free Trial | ➤ Try a Free Trial | ➤ Try a Free Trial | |||
| Sandoz | FLUOROURACIL | fluorouracil | INJECTABLE;INJECTION | 091299-001 | May 2, 2011 | DISCN | No | No | ➤ Try a Free Trial | ➤ Try a Free Trial | ➤ Try a Free Trial | ||||
| Sagent Pharms | FLUOROURACIL | fluorouracil | INJECTABLE;INJECTION | 203608-002 | May 11, 2017 | AP | RX | No | No | ➤ Try a Free Trial | ➤ Try a Free Trial | ➤ Try a Free Trial | |||
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
see a sample report or, see our see our flat-rate plans
see a sample report or, see our see our flat-rate plans
