DrugPatentWatch Database Preview
ISONIAZID - Generic Drug Details
Join the DrugPatentWatch Referral Program Get access to a free drug patent landscape report or a free one-month subscription
What are the generic drug sources for isoniazid and what is the scope of patent protection?
Isoniazid
is the generic ingredient in eleven branded drugs marketed by Sandoz Inc, Sandoz, Roche, Anda Repository, Cmp Pharma Inc, Lannett, Dow Pharm, Medpointe Pharm Hlc, Novartis, Barr, Duramed Pharms Barr, Halsey, Hikma Intl Pharms, Impax Labs, Ivax Sub Teva Pharms, Lilly, Mk Labs, Nexgen Pharma Inc, Panray, Perrigo, Pharmavite, Phoenix Labs Ny, Purepac Pharm, Sun Pharm Industries, Thepharmanetwork Llc, Watson Labs, Whiteworth Town Plsn, Bristol Myers Squibb, Everylife, and Sanofi Aventis Us, and is included in forty-seven NDAs. Additional information is available in the individual branded drug profile pages.There are five drug master file entries for isoniazid. Nineteen suppliers are listed for this compound.
Summary for ISONIAZID
| US Patents: | 0 |
| Tradenames: | 11 |
| Applicants: | 30 |
| NDAs: | 47 |
| Drug Master File Entries: | 5 |
| Suppliers / Packagers: | 19 |
| Bulk Api Vendors: | 121 |
| Clinical Trials: | 174 |
| Patent Applications: | 7,689 |
| Formulation / Manufacturing: | see details |
| Drug Prices: | Drug price trends for ISONIAZID |
| DailyMed Link: | ISONIAZID at DailyMed |
Recent Clinical Trials for ISONIAZID
Identify potential brand extensions & 505(b)(2) entrants
| Sponsor | Phase |
|---|---|
| United States Department of Defense | Phase 3 |
| Otsuka Pharmaceutical Co., Ltd. | Phase 3 |
| Pfizer | Phase 3 |
Pharmacology for ISONIAZID
| Drug Class | Antimycobacterial |
Medical Subject Heading (MeSH) Categories for ISONIAZID
Synonyms for ISONIAZID
| [(4-Pyridinylcarbonyl)oxy]hydrazine |
| 101033-EP2272832A1 |
| 101033-EP2272972A1 |
| 101033-EP2272973A1 |
| 101033-EP2277872A1 |
| 101033-EP2295053A1 |
| 101033-EP2298776A1 |
| 101033-EP2301544A1 |
| 10319-EP2272972A1 |
| 10319-EP2272973A1 |
| 10319-EP2274983A1 |
| 10319-EP2275102A1 |
| 10319-EP2275401A1 |
| 10319-EP2277872A1 |
| 10319-EP2280000A1 |
| 10319-EP2280012A2 |
| 10319-EP2281563A1 |
| 10319-EP2289510A1 |
| 10319-EP2289876A1 |
| 10319-EP2295407A1 |
| 10319-EP2295411A1 |
| 10319-EP2295416A2 |
| 10319-EP2295433A2 |
| 10319-EP2298312A1 |
| 10319-EP2298736A1 |
| 10319-EP2298747A1 |
| 10319-EP2298748A2 |
| 10319-EP2301536A1 |
| 10319-EP2301538A1 |
| 10319-EP2301924A1 |
| 10319-EP2305640A2 |
| 10319-EP2305642A2 |
| 10319-EP2305808A1 |
| 10319-EP2308852A1 |
| 10319-EP2311455A1 |
| 10319-EP2311824A1 |
| 10319-EP2311830A1 |
| 10319-EP2314584A1 |
| 10319-EP2316452A1 |
| 10319-EP2316459A1 |
| 10319-EP2380872A1 |
| 37271-10-6 |
| 4-(Hydrazinocarbonyl)pyridine |
| 4-pyridinecarbohydrazide |
| 4-pyridinecarbohydrazide(Isoniazid) |
| 4-Pyridinecarbonylhydrazine |
| 4-Pyridinecarboxylic acid hydrazide |
| 4-Pyridinecarboxylic acid, hydrazide |
| 4-Pyridinecarboxylic hydrazide |
| 4-Pyridylcarbonyl hydrazide |
| 4-Pyridylcarbonylhydrazide |
| 40687-EP2298761A1 |
| 40687-EP2311830A1 |
| 41466-07-3 |
| 5015 R.P |
| 5015 R.P. |
| 5015 RP |
| 54-85-3 |
| 62229-51-0 |
| 7640-37-1 |
| AB00052025 |
| AB00052025_22 |
| AB00052025_23 |
| AB00052025_24 |
| AB00052025_25 |
| AB00052025-20 |
| AB00052025-21 |
| AB1009474 |
| Abdizide |
| AC1L1GNZ |
| AC1Q54UP |
| AC1Q54UQ |
| ACMC-209ljq |
| AE-641/02310003 |
| AI3-23936 |
| AJ-08054 |
| AK-46317 |
| AKOS000119062 |
| AN-24420 |
| Andrazide |
| Anidrasona |
| Antimicina |
| Antituberkulosum |
| ANW-32196 |
| Armacide |
| Armazid |
| Armazide |
| ARONIS25141 |
| Atcotibine |
| AZT + Isoniazid |
| Azuren |
| bacillen |
| Bacillin |
| BB 0240534 |
| BBL008409 |
| BC204682 |
| BCP13791 |
| BDBM50336507 |
| BIDD:GT0140 |
| Biomol-NT_000288 |
| bp 5 015 |
| BP 5015 |
| BPBio1_000025 |
| BPBio1_001322 |
| BRD-K87202646-001-26-8 |
| BSPBio_000021 |
| BSPBio_002204 |
| C07054 |
| C6H7N3O |
| CAS-54-85-3 |
| CCG-39710 |
| CCRIS 351 |
| Cedin |
| Cedin (Aerosol) |
| Cemidon |
| CHEBI:6030 |
| CHEMBL64 |
| Chemiazid |
| Chemidon |
| component of Niadox (Salt/Mix) |
| Continazine |
| Cortinazine |
| Cotinazin |
| Cotinizin |
| CPD000059082 |
| CS-2371 |
| D00346 |
| DB00951 |
| Defonin |
| Dibutin |
| Diforin |
| Dinacrin |
| Ditubin |
| DivK1c_000070 |
| Dow-Isoniazid |
| DSSTox_CID_755 |
| DSSTox_GSID_20755 |
| DSSTox_RID_75771 |
| DTXSID8020755 |
| Ebidene |
| EINECS 200-214-6 |
| Epitope ID:141801 |
| Eralon |
| Ertuban |
| Eutizon |
| Evalon |
| F0391-0007 |
| Fetefu |
| Fimalene |
| FRS-3 |
| FSR 3 |
| FSR-3 |
| FT-0627424 |
| GINK |
| HIA |
| Hid rasonil |
| Hidranizil |
| Hidrasonil |
| Hidrulta |
| Hidrun |
| HMS1568B03 |
| HMS1920H09 |
| HMS2089I16 |
| HMS2091N19 |
| HMS2095B03 |
| HMS2234G04 |
| HMS3259E19 |
| HMS3373O01 |
| HMS3655L03 |
| HMS3712B03 |
| HMS500D12 |
| HSDB 1647 |
| HY-B0329 |
| Hycozid |
| Hydra |
| Hydrazid |
| Hydrazide |
| Hyozid |
| Hyzyd |
| I.A.I |
| I.A.I. |
| I0138 |
| I14-9731 |
| IDI1_000070 |
| Ido-tebin |
| Idrazide dell'acido isonicotinico |
| Idrazide dell'acido isonicotinico [Italian] |
| Idrazil |
| In-73 |
| Inah |
| InChI=1/C6H7N3O/c7-9-6(10)5-1-3-8-4-2-5/h1-4H,7H2,(H,9,10 |
| INH |
| Inh-Burgthal |
| INH; Isonicotinic acid hydrazide; Isonicotinic hydrazide |
| INHd20 |
| Inizid |
| Iscotin |
| Isidrina |
| Ismazide |
| Isobicina |
| Isocid |
| Isocidene |
| isoco tin |
| Isocotin |
| Isohydrazide |
| Isokin |
| Isolyn |
| Isonerit |
| Isonex |
| Isoniacid |
| isoniazid (inh) |
| Isoniazid (JP17/USP/INN) |
| Isoniazid (Tubizid) |
| Isoniazid [INN:BAN:JAN] |
| Isoniazid [USP:INN:BAN:JAN] |
| Isoniazid daily for 9 months |
| Isoniazid SA |
| Isoniazid, analytical standard, >=99% (TLC) |
| Isoniazid, certified reference material, TraceCERT(R) |
| Isoniazid, European Pharmacopoeia (EP) Reference Standard |
| Isoniazid, Pharmaceutical??Secondary??Standard;??Certified??Reference??Material |
| Isoniazid, United States Pharmacopeia (USP) Reference Standard |
| Isoniazid, Vetec(TM) reagent grade, 98% |
| Isoniazid(Tubizid) |
| Isoniazida |
| Isoniazida [INN-Spanish] |
| Isoniazide |
| Isoniazidum |
| Isoniazidum [INN-Latin] |
| Isonicazide |
| Isonicid |
| Isonico |
| Isonicotan |
| Isonicotil |
| isonicotinate hydrazide |
| Isonicotinhydrazid |
| isonicotinhydrazide |
| Isonicotinic acid hydrazide |
| Isonicotinic acid hydrazide (Isoniazid) |
| Isonicotinic acid hydrazide, 99% |
| Isonicotinic acid hydrazide(Isoniazid) |
| ISONICOTINIC ACID HYDRAZIDE(ISONIAZIDE) |
| isonicotinic acid hydrazone |
| Isonicotinic hydrazide |
| isonicotinicacid hydrazide |
| Isonicotinohydrazide |
| Isonicotinoyl hydrazide |
| isonicotinoylhydrazide |
| Isonicotinoylhydrazine |
| Isonicotinsaeurehydrazid |
| Isonicotinsaeurehydrazid [German] |
| Isonicotinyl hydrazide |
| Isonicotinyl hydrazine |
| Isonicotinylhydrazide |
| Isonicotinylhydrazine |
| Isonide |
| Isonidrin |
| Isonikazid |
| Isonilex |
| Isonin |
| Isonindon |
| Isonirit |
| Isoniton |
| Isonizida |
| Isonizide |
| Isotamine |
| Isotebe |
| Isotebezid |
| Isotinyl |
| Isozid |
| isozid e |
| Isozide |
| Isozyd |
| KB-100175 |
| KB-52787 |
| KBio1_000070 |
| KBio2_001333 |
| KBio2_003901 |
| KBio2_006469 |
| KBio3_001424 |
| KBioGR_000423 |
| KBioSS_001333 |
| KS-00000JHE |
| KS-0000471R |
| KSC-27-048 |
| KUC109571N |
| L 1945 |
| Laniazid |
| Laniazid (TN) |
| Laniozid |
| LANIZID |
| LS-205 |
| Mayambutol |
| MCULE-6324947959 |
| MFCD00006426 |
| MFCD00006426 (97%) |
| MLS000069444 |
| MLS001055327 |
| MolPort-000-141-557 |
| Mybasan |
| NC00513 |
| NCGC00016244-01 |
| NCGC00016244-02 |
| NCGC00016244-03 |
| NCGC00016244-04 |
| NCGC00016244-05 |
| NCGC00016244-06 |
| NCGC00016244-07 |
| NCGC00016244-08 |
| NCGC00016244-09 |
| NCGC00016244-10 |
| NCGC00016244-11 |
| NCGC00016244-12 |
| NCGC00016244-14 |
| NCGC00016244-15 |
| NCGC00022648-03 |
| NCGC00022648-04 |
| NCGC00022648-05 |
| NCGC00022648-06 |
| NCGC00022648-07 |
| NCGC00254094-01 |
| NCGC00258919-01 |
| Neo-Tizide |
| Neoteben |
| Neoxin |
| Neumandin |
| Nevin |
| Niadrin |
| Nicazide |
| Nicetal |
| Nicizina |
| Niconyl |
| Nicotibina |
| Nicotibine |
| Nicotisan |
| Nicozide |
| Nidaton |
| nidra zid |
| Nidrazid |
| Nikozid |
| NINDS_000070 |
| Niplen |
| Nitadon |
| Niteban |
| Nitebannsc 9659 |
| NIZ |
| NSC 9659 |
| NSC-757078 |
| NSC-9659 |
| NSC757078 |
| NSC9659 |
| Nydrazid |
| Nyscozid |
| Opera_ID_454 |
| Oprea1_396155 |
| Pelazid |
| Percin |
| Pharmakon1600-01500355 |
| Phthisen |
| Preparation 6424 |
| Prestwick_578 |
| Prestwick0_000161 |
| Prestwick1_000161 |
| Prestwick2_000161 |
| Prestwick3_000161 |
| PS-4129 |
| Pycazide |
| Pyreazid |
| Pyricidin |
| Pyridicin |
| pyridine-4-carbohydrazide |
| pyridine-4-carboxylic acid hydrazide |
| Pyrizidin |
| QRXWMOHMRWLFEY-UHFFFAOYSA-N |
| Raumanon |
| Razide |
| Retozide |
| Rifater (Salt/Mix) |
| Rimicid |
| rimif on |
| Rimifon |
| Rimiphone |
| Rimitsid |
| Robiselin |
| Robisellin |
| Roxifen |
| RP 5015 |
| RP-5015 |
| RP01120 |
| RTR-019381 |
| RU-EF-Tb |
| RY-EF-Tb |
| s1937 |
| SAM002554904 |
| Sanohidrazina |
| Sauterazid |
| Sauterzid |
| SBB004195 |
| SBI-0051419.P003 |
| SC-12623 |
| SCHEMBL228 |
| SCHEMBL2998929 |
| SMR000059082 |
| Soniazid,(S) |
| SPBio_000094 |
| SPBio_001942 |
| Spectrum_000853 |
| SPECTRUM1500355 |
| Spectrum2_000107 |
| Spectrum3_000472 |
| Spectrum4_000022 |
| Spectrum5_000876 |
| SR-01000003025 |
| SR-01000003025-2 |
| SR-01000003025-3 |
| ST078858 |
| ST24025094 |
| Stanozide |
| STK086288 |
| STR00210 |
| SW196752-3 |
| SY010614 |
| T7976 |
| TB-Phlogin |
| TB-Razide |
| TB-Vis |
| Tebecid |
| tebemid |
| Tebenic |
| Tebexin |
| Tebilon |
| Tebos |
| Teebaconin |
| Tekazin |
| Tibazide |
| Tibemid |
| Tibiazide |
| Tibinide |
| Tibison |
| Tibivis |
| Tibizide |
| Tibusan |
| Tisin |
| Tisiodrazida |
| Tizide |
| Tox21_113640 |
| Tox21_113640_1 |
| Tox21_201367 |
| Tox21_300193 |
| TR-019381 |
| Tubazid |
| Tubazide |
| Tubeco |
| Tubecotubercid |
| tubercid |
| Tuberian |
| Tubicon |
| Tubilysin |
| Tubizid |
| Tubomel |
| Tyvid |
| Unicocyde |
| Unicozyde |
| UNII-V83O1VOZ8L |
| UPCMLD0ENAT5791176:001 |
| Usaf cb-2 |
| V83O1VOZ8L |
| Vazadrine |
| Vederon |
| WLN: T6NJ DVMZ |
| Z58981801 |
| ZB000368 |
| Zidafimia |
| Zinadon |
| ZINC1590 |
| Zonazide |
US Patents and Regulatory Information for ISONIAZID
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hikma Intl Pharms | ISONIAZID | isoniazid | TABLET;ORAL | 080212-001 | Approved Prior to Jan 1, 1982 | DISCN | No | No | Start Trial | Start Trial | Start Trial | ||||
| Phoenix Labs Ny | ISONIAZID | isoniazid | TABLET;ORAL | 080368-002 | Approved Prior to Jan 1, 1982 | DISCN | No | No | Start Trial | Start Trial | Start Trial | ||||
| Panray | ISONIAZID | isoniazid | TABLET;ORAL | 008428-002 | Approved Prior to Jan 1, 1982 | DISCN | No | No | Start Trial | Start Trial | Start Trial | ||||
| Watson Labs | ISONIAZID | isoniazid | TABLET;ORAL | 083178-001 | Approved Prior to Jan 1, 1982 | DISCN | No | No | Start Trial | Start Trial | Start Trial | ||||
| Duramed Pharms Barr | ISONIAZID | isoniazid | TABLET;ORAL | 088231-001 | Mar 17, 1983 | DISCN | No | No | Start Trial | Start Trial | Start Trial | ||||
| >Applicant | >Tradename | >Generic Name | >Dosage | >NDA | >Approval Date | >TE | >Type | >RLD | >RS | >Patent No. | >Patent Expiration | >Product | >Substance | >Delist Req. | >Exclusivity Expiration |
Make Better Decisions: Try a trial or see plans & pricing
Serving leading biopharmaceutical companies globally:
Drugs may be covered by multiple patents or regulatory protections. All trademarks and applicant names are the property of their respective owners or licensors. Although great care is taken in the proper and correct provision of this service, thinkBiotech LLC does not accept any responsibility for possible consequences of errors or omissions in the provided data. The data presented herein is for information purposes only. There is no warranty that the data contained herein is error free. thinkBiotech performs no independent verifification of facts as provided by public sources nor are attempts made to provide legal or investing advice. Any reliance on data provided herein is done solely at the discretion of the user. Users of this service are advised to seek professional advice and independent confirmation before considering acting on any of the provided information. thinkBiotech LLC reserves the right to amend, extend or withdraw any part or all of the offered service without notice.
Copyright 2002-2019 thinkBiotech LLC
ISSN: 2162-2639
Privacy and Cookies
Terms & Conditions
Site Map
DrugPatentWatch Alternatives
LOE / Major Patent Expirations 2019 - 2020
NCE-1 Patent Challenge Dates 2019 - 2020
ISSN: 2162-2639
Privacy and Cookies
Terms & Conditions
Site Map
DrugPatentWatch Alternatives
LOE / Major Patent Expirations 2019 - 2020
NCE-1 Patent Challenge Dates 2019 - 2020
Preferred Citation:
Friedman, Yali. "DrugPatentWatch" DrugPatentWatch, thinkBiotech, 2019, www.DrugPatentWatch.com.