DrugPatentWatch Database Preview
LIALDA Drug Profile
or, see our see our flat-rate plans
When do Lialda patents expire, and what generic alternatives are available?
This drug has thirty-one patent family members in seventeen countries.
The generic ingredient in LIALDA is mesalamine. There are twenty-eight drug master file entries for this compound. Twenty-one suppliers are listed for this compound. Additional details are available on the mesalamine profile page.
Summary for LIALDA
| International Patents: | 31 |
| US Patents: | 1 |
| Applicants: | 1 |
| NDAs: | 1 |
| Suppliers / Packagers: | 3 |
| Bulk Api Vendors: | 126 |
| Clinical Trials: | 9 |
| Patent Applications: | 4,311 |
| Formulation / Manufacturing: | see details |
| Patent Litigation and PTAB cases: | See patent lawsuits and PTAB cases for LIALDA |
| DailyMed Link: | LIALDA at DailyMed |
Pharmacology for LIALDA
| Ingredient-type | Aminosalicylic Acids |
| Drug Class | Aminosalicylate |
Medical Subject Heading (MeSH) Categories for LIALDA
Synonyms for LIALDA
| 1764-EP2272825A2 |
| 1764-EP2275420A1 |
| 2-Hydroxy-5-aminobenzoic acid |
| 24215-EP2289518A1 |
| 24215-EP2295053A1 |
| 24215-EP2295409A1 |
| 24215-EP2314574A1 |
| 24215-EP2314590A1 |
| 3-amino-6-hydroxybenzoic acid |
| 3-carboxy-4-hydroxyaniline |
| 35589-28-7 (mono-hydrochloride salt) |
| 3amino-6-hydroxybenzoic acid |
| 4-14-00-02058 (Beilstein Handbook Reference) |
| 4Q81I59GXC |
| 5 Aminosalicylate |
| 5 Aminosalicylic Acid |
| 5-?Aminosalicylic Acid (Mesalazine) |
| 5-Amino Salicylic Acid |
| 5-amino-2-hydroxy-benzoic acid |
| 5-Amino-2-hydroxybenzoic acid |
| 5-Amino-2-hydroxybenzoic acid 97% |
| 5-Amino-2-hydroxybenzoic acid; 5-AS; Mesalamine; 5-ASA |
| 5-amino-2-hydroxybenzoicacid |
| 5-amino-salicylic acid |
| 5-Aminosalicyclic acid |
| 5-Aminosalicylate |
| 5-Aminosalicylic acid |
| 5-Aminosalicylic acid, >=99% |
| 5-Aminosalicylic acid, 95% |
| 5-Aminosalicylic acid, analytical standard |
| 5-aminosalicylic acid, Mesalazine, Asacol, Pentasa, Canasa, Mesalamine |
| 5-Aminosalicylic Acid, Purified |
| 5-Aminosalicylic acid, tablet |
| 5-Aminosalicylicacid |
| 5-AS |
| 5-ASA |
| 61513-32-4 |
| 6291-36-7 (hydrochloride) |
| 89-57-6 |
| 90701-EP2371811A2 |
| A0317 |
| A3613/0153179 |
| AB00374979 |
| AB00374979_11 |
| AB00374979_12 |
| AB00374979-09 |
| AB00374979-10 |
| AB1001921 |
| AC-2764 |
| AC1L1HCS |
| AC1Q51L9 |
| ACMC-1BKFR |
| ACN-S002469 |
| AI3-15564 |
| AJ-08068 |
| AJG-501 |
| AK-72925 |
| AKOS000118959 |
| Allphar Brand of Mesalamine |
| AM20060091 |
| AN-874 |
| Antigen Brand of Mesalamine |
| ANW-39326 |
| Apriso |
| Apriso (TN) |
| ARONIS23914 |
| Asacol |
| Asacol (TN) |
| Asacol HD |
| Asacolitin |
| Asacolon |
| Asalit |
| Ascolitin |
| Axcan Brand of Mesalamine |
| BB_NC-0015 |
| BBL013046 |
| BCP9000175 |
| BDBM60918 |
| Benzoic acid, 5-amino-2-hydroxy- |
| BIDD:GT0811 |
| BP-13074 |
| BPBio1_001164 |
| BR-72925 |
| BRN 2090421 |
| BSPBio_001058 |
| Byk Brand of Mesalamine |
| Canasa |
| Canasa (TN) |
| CAS-89-57-6 |
| CCG-100829 |
| CCRIS 7334 |
| Celltech Brand of Mesalamine |
| CHEBI:6775 |
| CHEMBL704 |
| cid_4075 |
| Claversal |
| cMAP_000045 |
| CPD000145728 |
| CS-2219 |
| CTK3E8105 |
| D00377 |
| D0C4YC |
| DB00244 |
| Delzicol |
| Delzicol (TN) |
| DSSTox_CID_4506 |
| DSSTox_GSID_24506 |
| DSSTox_RID_77435 |
| DTXSID5024506 |
| EC 201-919-1 |
| EINECS 201-919-1 |
| F1918-0003 |
| Falk Brand of Mesalamine |
| Farmasa Brand of Mesalamine |
| FC1035 |
| Ferring Brand of Mesalamine |
| Fisalamine |
| Fivasa |
| FT-0619950 |
| GlaxoSmithKline Brand of Mesalamine |
| GTPL2700 |
| Henning Berlin Brand of Mesalamine |
| HMS1571E20 |
| HMS2051M21 |
| HMS2090I09 |
| HMS2098E20 |
| HMS3393M21 |
| HMS3649K15 |
| HMS3651M15 |
| HS-0100 |
| HSDB 7512 |
| HY-15027 |
| Hydrochloride, Mesalamine |
| I06-0488 |
| Iialda |
| Iialda (TN) |
| InChI=1/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11 |
| Ipocal (TN) |
| Ipocol |
| KB-196569 |
| KB-196728 |
| KBio2_002425 |
| KBio2_004993 |
| KBio2_007561 |
| KBio3_002904 |
| KBioGR_002425 |
| KBioSS_002431 |
| KBOPZPXVLCULAV-UHFFFAOYSA-N |
| KS-00000CC5 |
| KS-000048PQ |
| KSC448C0L |
| Lialda (TN) |
| Lixacol |
| LS-1894 |
| LS11426 |
| m Aminosalicylic Acid |
| M-7246 |
| m-Aminosalicylic acid |
| Masacol (TN) |
| MAX-002 |
| MCULE-5752745805 |
| MD-0901 |
| Merckle Brand of Mesalamine |
| Mesacol |
| mesalamine |
| Mesalamine (Lialda) |
| Mesalamine (TN) |
| mesalamine (USAN) |
| Mesalamine (USP) |
| Mesalamine [USAN:USP] |
| Mesalamine [USAN] |
| Mesalamine HCl |
| Mesalamine Monosodium Salt |
| Mesalamine, pharmaceutical secondary standard; traceable to USP, PhEur and BP |
| Mesalamine, United States Pharmacopeia (USP) Reference Standard |
| Mesalamine|||Mesalazine |
| Mesalazina |
| Mesalazina [Spanish] |
| Mesalazina[Spanish] |
| Mesalazine |
| Mesalazine (JAN/INN) |
| Mesalazine [INN] |
| Mesalazine for system suitability, European Pharmacopoeia (EP) Reference Standard |
| Mesalazine MMX |
| Mesalazine, European Pharmacopoeia (EP) Reference Standard |
| Mesalazinum |
| Mesalazinum [Latin] |
| mesalsal |
| Mesasal |
| Mesavance |
| Mesavancol |
| meta Aminosalicylic Acid |
| meta-Aminosalicylic Acid |
| Meta-AminosalicylicAcid |
| Mezavant |
| Mezavant XL |
| MFCD00007877 |
| minosalicylic acid |
| MLS000758287 |
| MLS001424012 |
| MolPort-001-641-024 |
| Monosodium Salt, Mesalamine |
| NC00079 |
| NCGC00016344-01 |
| NCGC00016344-02 |
| NCGC00016344-03 |
| NCGC00016344-04 |
| NCGC00016344-05 |
| NCGC00016344-07 |
| NCGC00090934-01 |
| NCGC00090934-02 |
| NCGC00257142-01 |
| NCGC00259159-01 |
| Norgine Brand of Mesalamine |
| Novo 5 ASA |
| Novo-5 ASA |
| Novo5 ASA |
| Novopharm Brand of Mesalamine |
| NSC 38877 |
| NSC-38877 |
| NSC-759301 |
| NSC38877 |
| NSC759301 |
| Oprea1_847633 |
| OR011141 |
| OR174775 |
| p-Aminosalicylsaeure |
| p-Aminosalicylsaeure [German] |
| Pentacol |
| Pentasa |
| Pentasa (TN) |
| Pharmakon1600-01505993 |
| Prestwick0_001069 |
| Prestwick1_001069 |
| Prestwick2_001069 |
| Prestwick3_001069 |
| Procter & Gamble Brand of Mesalamine |
| Provalis Brand of Mesalamine |
| PubChem17623 |
| Q-201355 |
| Rowasa |
| Rowasa (TN) |
| RP21708 |
| RTR-032941 |
| s1681 |
| SALICYLIC ACID, 5-AMINO- |
| Salicylic acid, 5-amino-(8CI) |
| Salofalk |
| Salofalk (TN) |
| Salofalk Granu-Stix |
| Salozinal |
| SAM001247020 |
| Sanofi Synthelabo Brand of Mesalamine |
| SBB052617 |
| SC-15695 |
| SCHEMBL31297 |
| Schering Plough Brand of Mesalamine |
| Schering-Plough Brand of Mesalamine |
| sfRowasa |
| Sfrowasa (TN) |
| SmithKline Brand of Mesalamine |
| SMR000145728 |
| Solvay Brand of Mesalamine |
| SPBio_002969 |
| SPD 476 |
| SPD-476 |
| SPD-480 |
| SR-01000763486 |
| SR-01000763486-9 |
| ST2411704 |
| ST4109571 |
| STK301678 |
| Tox21_110384 |
| Tox21_110384_1 |
| Tox21_201610 |
| Tox21_303125 |
| TR-032941 |
| TRA0073805 |
| UNII-4Q81I59GXC |
| WLN: ZR DQ CVQ |
| Yamanouchi Brand of Mesalamine |
| Z-206 |
| Z57127471 |
| ZINC1688 |
US Patents and Regulatory Information for LIALDA
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Shire | LIALDA | mesalamine | TABLET, DELAYED RELEASE;ORAL | 022000-001 | Jan 16, 2007 | AB | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | Y | ➤ Sign Up | ||
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
or, see our see our flat-rate plans
Paragraph IV (Patent) Challenges for LIALDA
| Drugname | Dosage | Strength | RLD | Submissiondate |
|---|---|---|---|---|
| ➤ Subscribe | Delayed-release Tablets | 1.2 g | ➤ Subscribe | 2009-12-16 |
or, see our see our flat-rate plans
