DrugPatentWatch Database Preview
GOCOVRI Drug Profile
Which patents cover Gocovri, and when can generic versions of Gocovri launch?
Gocovri is a drug marketed by Adamas Pharma and is included in one NDA. There are fourteen patents protecting this drug and one Paragraph IV challenge.
This drug has twenty-two patent family members in seven countries.
The generic ingredient in GOCOVRI is amantadine hydrochloride. There are seven drug master file entries for this compound. Forty-five suppliers are listed for this compound. Additional details are available on the amantadine hydrochloride profile page.
Summary for GOCOVRI
| International Patents: | 22 |
| US Patents: | 14 |
| Applicants: | 1 |
| NDAs: | 1 |
| Suppliers / Packagers: | 1 |
| Bulk Api Vendors: | 128 |
| Patent Applications: | 6,754 |
| Formulation / Manufacturing: | see details |
| Drug Prices: | Drug price information for GOCOVRI |
| Patent Litigation and PTAB cases: | See patent lawsuits and PTAB cases for GOCOVRI |
| Prior Art and Litigation Support | Order Prior Art and Litigation support for GOCOVRI |
| DailyMed Link: | GOCOVRI at DailyMed |
Medical Subject Heading (MeSH) Categories for GOCOVRI
Synonyms for GOCOVRI
| (3R,5S,7s)-Adamantan-1-amine |
| (3s,5s,7s)-Tricyclo[3.3.1.1~3,7~]decan-1-Amine |
| 1-Adamantamine |
| 1-Adamantamine(1-Aminoadamantane) |
| 1-Adamantanamine |
| 1-Adamantanamine (8CI) |
| 1-Adamantanamine, 96% |
| 1-adamantaneamine |
| 1-adamantanylamine |
| 1-adamantyl amine |
| 1-Adamantylamine |
| 1-Adamantylamine, 97% |
| 1-Amantadine |
| 1-amino-adamantane |
| 1-Aminoadamantane |
| 1-Aminotricyclo(3.3.1.1(sup 3,7))decane |
| 665-66-7 (hydrochloride) |
| 744952-70-3 |
| 768-94-5 |
| 768A945 |
| A838887 |
| AB00053414_17 |
| AB00053414_18 |
| AB00053414-14 |
| AB00053414-16 |
| AB0014168 |
| AB00514655 |
| AB01275427-01 |
| AC-25879 |
| AC1L1CZI |
| AC1Q4UAF |
| AC1Q5396 |
| ACT02873 |
| Adamant-1-ylamine |
| Adamantamine |
| adamantan-1-amine |
| adamantan-1-ylamine |
| Adamantanamine |
| adamantane-1-amine |
| ADAMANTANE,1-AMINO |
| adamantaneamine |
| adamantanylamine |
| adamantyl amine |
| Adamantylamine |
| ADS-5102, EXP 105-1 |
| AE-641/01634060 |
| AJ-24589 |
| AK-77141 |
| AKOS000113994 |
| AKOS000119324 |
| AKOS007930692 |
| AKOS015935124 |
| AKOS022142354 |
| ALBB-013871 |
| Amant |
| Amantadina |
| Amantadina [INN-Spanish] |
| amantadine |
| Amantadine (INN) |
| Amantadine [INN:BAN] |
| Amantadine Base |
| Amantadinum |
| Amantadinum [INN-Latin] |
| Amantidine |
| Aminoadamantane |
| AN-47537 |
| ANW-43040 |
| AS-14215 |
| AX8000305 |
| BBL004977 |
| BBV-38789958 |
| BC227869 |
| BCP09869 |
| BDBM50033369 |
| BF4C9Z1J53 |
| BIA4304 |
| BIDD:GT0757 |
| BP-13040 |
| BPBio1_000368 |
| BRD-K70330367-003-01-2 |
| BRD-K70330367-003-03-8 |
| BRN 2204333 |
| BSPBio_000334 |
| BSPBio_001570 |
| BSPBio_001822 |
| C-02982 |
| C06818 |
| CA-1981 |
| CAS-768-94-5 |
| CC-03900 |
| CCG-204100 |
| CHEBI:2618 |
| CHEMBL19601 |
| CHEMBL660 |
| CS-W008656 |
| CTK3J2792 |
| D07441 |
| DB00915 |
| DivK1c_000815 |
| DKNWSYNQZKUICI-UHFFFAOYSA-N |
| DSSTox_CID_2117 |
| DSSTox_GSID_22117 |
| DSSTox_RID_76493 |
| DTXSID8022117 |
| EC 212-201-2 |
| EINECS 212-201-2 |
| EN300-33893 |
| Endantadine |
| Exp-105-1 (Salt/Mix) |
| F0001-1962 |
| FCH2250665 |
| FT-0607338 |
| Gen-Amantadine |
| GTPL4128 |
| HMS1791O12 |
| HMS1989O12 |
| HMS3604O07 |
| HSDB 3202 |
| HTS001826 |
| I14-1101 |
| IDI1_000815 |
| InChI=1/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H |
| J-650234 |
| K333 |
| KB-87149 |
| KBio1_000815 |
| KBio2_000390 |
| KBio2_002958 |
| KBio2_005526 |
| KBio3_001322 |
| KBioGR_000548 |
| KBioSS_000390 |
| KS-00000X47 |
| KSC492O9F |
| L000868 |
| Lopac-A-1260 |
| Lopac0_000004 |
| LS-157049 |
| M-4039 |
| Mantadine |
| Mantadine (Salt/Mix) |
| MCULE-9686682307 |
| MFCD00074732 |
| MolPort-001-661-700 |
| MolPort-001-791-102 |
| MolPort-015-137-498 |
| NCGC00015036-01 |
| NCGC00015036-02 |
| NCGC00015036-03 |
| NCGC00015036-04 |
| NCGC00015036-05 |
| NCGC00015036-06 |
| NCGC00015036-07 |
| NCGC00015036-08 |
| NCGC00015036-09 |
| NCGC00015036-11 |
| NCGC00015036-13 |
| NCGC00162039-01 |
| NCGC00162039-02 |
| NCGC00162039-03 |
| NCGC00162039-04 |
| NCGC00179597-01 |
| NCIOpen2_001059 |
| NINDS_000815 |
| NSC 341865 |
| NSC-341865 |
| NSC341865 |
| NSC83653 |
| Oprea1_248648 |
| OR14310 |
| Pk-merz |
| Prestwick0_000407 |
| Prestwick1_000407 |
| Prestwick2_000407 |
| Prestwick3_000407 |
| PubChem13903 |
| PubChem8733 |
| RP21518 |
| RT-001031 |
| SBB071506 |
| SBI-0049993.P004 |
| SC-06708 |
| SCHEMBL15672299 |
| SCHEMBL20409394 |
| SCHEMBL2619248 |
| SCHEMBL4098 |
| SPBio_000002 |
| SPBio_002273 |
| Spectrum_000030 |
| Spectrum2_000081 |
| Spectrum3_000291 |
| Spectrum4_000134 |
| Spectrum5_000772 |
| ST097860 |
| ST2412621 |
| STK298781 |
| STR04703 |
| Symadine |
| Symmetrel (Salt/Mix) |
| TCMDC-125869 |
| TL8005280 |
| Tox21_110068 |
| Tox21_110068_1 |
| TRA0073510 |
| Tricyclo(3.3.1.1(3,7))-decan-1-amine |
| Tricyclo(3.3.1.1(sup 3,7))decan-1-amine |
| Tricyclo(3.3.1.1(sup 3.7))decan-1-amine |
| Tricyclo(3.3.1.13,7)decan-1-amine |
| Tricyclo[3.3.1.1^3,7]decan-1-amine |
| Tricyclo[3.3.1.1(3,7)]decan-1-amine |
| tricyclo[3.3.1.1(3,7)]decan-1-ylamine |
| tricyclo[3.3.1.1(3,7)]decane-1-amine |
| Tricyclo[3.3.1.1(sup3,7)]decan-1-amine |
| tricyclo[3.3.1.1~3,7~]decan-1-amine |
| Tricyclo[3.3.1.13,7]decan-1-amine |
| Tricyclo[3.3.1.13,7]decane-1-amine |
| UNII-BF4C9Z1J53 |
| W-104338 |
| Wiregyt |
| WLN: L66 B6 A B- C 1B ITJ BZ |
| ZINC968256 |
| ZX-AFC001530 |
| ZX-AN012620 |
| ZX-AT007596 |
US Patents and Regulatory Information for GOCOVRI
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Adamas Pharma | GOCOVRI | amantadine hydrochloride | CAPSULE, EXTENDED RELEASE;ORAL | 208944-002 | Aug 24, 2017 | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Adamas Pharma | GOCOVRI | amantadine hydrochloride | CAPSULE, EXTENDED RELEASE;ORAL | 208944-002 | Aug 24, 2017 | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | Y | ➤ Sign Up | |||
| Adamas Pharma | GOCOVRI | amantadine hydrochloride | CAPSULE, EXTENDED RELEASE;ORAL | 208944-002 | Aug 24, 2017 | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | Y | ➤ Sign Up | |||
| Adamas Pharma | GOCOVRI | amantadine hydrochloride | CAPSULE, EXTENDED RELEASE;ORAL | 208944-001 | Aug 24, 2017 | RX | Yes | No | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Adamas Pharma | GOCOVRI | amantadine hydrochloride | CAPSULE, EXTENDED RELEASE;ORAL | 208944-002 | Aug 24, 2017 | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
Paragraph IV (Patent) Challenges for GOCOVRI
| Drugname | Dosage | Strength | RLD | Date |
|---|---|---|---|---|
| ➤ Subscribe | Extended-release Capsules | 137 mg | ➤ Subscribe | ➤ Sign Up |
International Patents for GOCOVRI
| Country | Patent Number | Estimated Expiration |
|---|---|---|
| Canada | 2782556 | ➤ Sign Up |
| World Intellectual Property Organization (WIPO) | 2006058236 | ➤ Sign Up |
| Canada | 2994873 | ➤ Sign Up |
| China | 102883601 | ➤ Sign Up |
| Japan | 2017019874 | ➤ Sign Up |
| Country | Patent Number | Estimated Expiration |
