DrugPatentWatch Database Preview
RADICAVA Drug Profile
When do Radicava patents expire, and when can generic versions of Radicava launch?
Radicava is a drug marketed by Mitsubishi Tanabe and is included in one NDA. There is one patent protecting this drug.
This drug has seven patent family members in six countries.
The generic ingredient in RADICAVA is edaravone. One supplier is listed for this compound. Additional details are available on the edaravone profile page.
Summary for RADICAVA
| International Patents: | 7 |
| US Patents: | 1 |
| Applicants: | 1 |
| NDAs: | 1 |
| Suppliers / Packagers: | 1 |
| Bulk Api Vendors: | 123 |
| Clinical Trials: | 3 |
| Patent Applications: | 999 |
| Formulation / Manufacturing: | see details |
| Drug Prices: | Drug price information for RADICAVA |
| DailyMed Link: | RADICAVA at DailyMed |
Generic Entry Opportunity Date for RADICAVA
Generic Entry Date for RADICAVA*:
Constraining patent/regulatory exclusivity:
TREATMENT OF AMYOTROPHIC LATERAL SCLEROSIS (ALS) NDA:
Dosage:
SOLUTION;IV (INFUSION) |
*The generic entry opportunity date is the latter of the last compound-claiming patent and the last regulatory exclusivity protection. Many factors can influence early or later generic entry. This date is provided as a rough estimate of generic entry potential and should not be used as an independent source.
Recent Clinical Trials for RADICAVA
Identify potential brand extensions & 505(b)(2) entrants
| Sponsor | Phase |
|---|---|
| Mitsubishi Tanabe Pharma Corporation | Phase 1 |
| Brain Canada | Phase 2 |
| University of Calgary | Phase 2 |
Synonyms for RADICAVA
| (MCI-186) |
| 1-Fenyl-3-methyl-2-pyrazolin-5-on |
| 1-Fenyl-3-methyl-2-pyrazolin-5-on [Czech] |
| 1-PEHNYL-3-METHYL-5-PYRAZALONE |
| 1-Phenyl-3-methyl-2-pyrazolin-5-on |
| 1-Phenyl-3-methyl-5-oxo-2-pyrazoline |
| 1-Phenyl-3-methyl-5-pyrazolone |
| 1-Phenyl-3-methylpyrazolone |
| 1-Phenyl-3-methylpyrazolone-5 |
| 115566-83-1 |
| 12235-58-4 |
| 2 4-Dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one |
| 2-Pyrazolin-5-one, 3-methyl-1-phenyl- |
| 2,4-dihydro-2-phenyl-5-methyl-3H-pyrazol-3-one |
| 2,4-Dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one |
| 206195-95-1 |
| 3-Methyl-1-phenyl-1H-pyrazol-5(4H)-one |
| 3-METHYL-1-PHENYL-2-PYRAZOLIN-5-ONE |
| 3-METHYL-1-PHENYL-2-PYRAZOLIN-5-ONE (MCI-186) |
| 3-Methyl-1-phenyl-2-pyrazolin-5-one, 99% |
| 3-methyl-1-phenyl-2-pyrazolin-5one |
| 3-Methyl-1-phenyl-2-pyrazoline-5-one |
| 3-Methyl-1-phenyl-2-pyrazoline-5-one, 99% |
| 3-Methyl-1-phenyl-2-pyrazoline-5-one, purum, >=98.0% (NT) |
| 3-Methyl-1-phenyl-2-pyrazoline-5-one, SAJ special grade |
| 3-methyl-1-phenyl-4,5-dihydro-1H-pyrazol-5-one |
| 3-Methyl-1-phenylpyrazol-5-one |
| 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 3H-Pyrazol-3-one,4-dihydro-5-methyl-2-phenyl- |
| 4CA-0486 |
| 4E-901 |
| 5-methyl-2-phenyl-2,4-dihydro-3-pyrazolone |
| 5-Methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one |
| 5-Methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one (Edaravone) |
| 5-Methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one # |
| 5-methyl-2-phenyl-2,4-dihydro-pyrazol-3-one |
| 5-methyl-2-phenyl-2,4-dihydropyrazol-3-one |
| 5-methyl-2-phenyl-4H-pyrazol-3-one |
| 5-Pyrazolone, 3-methyl-1-phenyl- |
| 52224-17-6 |
| 62495-97-0 |
| 72134-66-8 |
| 89-25-8 |
| AB00375776_14 |
| AB00375776_15 |
| AB2000046 |
| AC-4745 |
| AC1L1H8H |
| AC1Q2PHG |
| AC1Q6EYP |
| ACT07289 |
| AE-641/00371017 |
| AI3-03557 |
| AJ-70469 |
| AK128848 |
| AKOS000313817 |
| AM20060748 |
| AN-11638 |
| Antipyrine Related Compound A, United States Pharmacopeia (USP) Reference Standard |
| BBL011741 |
| BC205186 |
| BCBcMAP01_000127 |
| BCP26336 |
| BCP9000635 |
| BCPP000246 |
| BDBM50200541 |
| Bio1_000438 |
| Bio1_000927 |
| Bio1_001416 |
| Bio2_000448 |
| Bio2_000928 |
| BRD-K35458079-001-04-2 |
| BRD-K35458079-001-12-5 |
| BRD-K35458079-001-23-2 |
| BRN 0609575 |
| BSPBio_001235 |
| BSPBio_002601 |
| C.I. Developer 1 |
| C13008 |
| CAS-89-25-8 |
| CCG-39352 |
| CCRIS 512 |
| CDS1_000986 |
| CHEBI:31530 |
| CHEMBL290916 |
| CI Developer 1 |
| CS-1832 |
| CTK3E8611 |
| D01552 |
| DB-002517 |
| DB12243 |
| Developer Z |
| DivK1c_001018 |
| DivK1c_002026 |
| DSSTox_CID_1130 |
| DSSTox_GSID_21130 |
| DSSTox_RID_75961 |
| DTXSID9021130 |
| EC 201-891-0 |
| edaravone |
| Edaravone (JP17/INN) |
| Edaravone (MCI-186) |
| Edaravone [USAN:INN] |
| edaravone(jan) |
| EINECS 201-891-0 |
| F0391-0021 |
| FT-0608243 |
| HMS1362M17 |
| HMS1792M17 |
| HMS1990M17 |
| HMS2234M19 |
| HMS3266F04 |
| HMS3403M17 |
| HMS3654L15 |
| HMS503K17 |
| HMS557M18 |
| HSDB 4102 |
| HY-B0099 |
| I01-2810 |
| IDI1_001018 |
| IDI1_002203 |
| IN1263 |
| InChI=1/C10H10N2O/c1-8-7-10(13)12(11-8)9-5-3-2-4-6-9/h2-6H,7H2,1H |
| KB-183502 |
| KBio1_001018 |
| KBio2_000575 |
| KBio2_000747 |
| KBio2_003143 |
| KBio2_003315 |
| KBio2_005711 |
| KBio2_005883 |
| KBio3_001029 |
| KBio3_001030 |
| KBio3_001821 |
| KBioGR_000575 |
| KBioGR_001502 |
| KBioSS_000575 |
| KBioSS_000747 |
| KS-00000X6I |
| KSC448M1D |
| LS-1892 |
| M0687 |
| Maybridge1_005738 |
| MCI-186 |
| MCI-186, Radicut, 89-25-8 |
| Methylphenylpyrazolone |
| MFCD00003138 |
| MLS000069602 |
| MLS001146878 |
| MLS002415675 |
| MLS006011753 |
| MolPort-000-182-197 |
| Monopyrazolone |
| NCGC00018218-01 |
| NCGC00018218-02 |
| NCGC00018218-03 |
| NCGC00018218-04 |
| NCGC00018218-05 |
| NCGC00018218-06 |
| NCGC00018218-07 |
| NCGC00018218-08 |
| NCGC00018218-10 |
| NCGC00018218-17 |
| NCGC00022665-02 |
| NCGC00022665-04 |
| NCGC00022665-05 |
| NCGC00022665-06 |
| NCGC00164015-01 |
| NCGC00256515-01 |
| NCGC00259296-01 |
| NCI-C03952 |
| NE10266 |
| NINDS_001018 |
| Norantipyrine |
| Norphenazone |
| NSC 12 |
| NSC-26139 |
| NSC-2629 |
| NSC-758622 |
| NSC26139 |
| NSC2629 |
| NSC758622 |
| Opera_ID_1057 |
| Pharmakon1600-01503635 |
| Phenazone impurity A, European Pharmacopoeia (EP) Reference Standard |
| Phenyl methyl pyrazolone |
| Phenylmethylpyrazolone |
| PubChem13301 |
| Q-200386 |
| QELUYTUMUWHWMC-UHFFFAOYSA-N |
| Radicava (TN) |
| Radicut |
| Radicut (TN) |
| Radicut;MCI-186 |
| RL05601 |
| RTR-028045 |
| s1326 |
| SB19128 |
| SBI-0051836.P002 |
| SC-13582 |
| SCHEMBL4704 |
| SMR000059020 |
| SPBio_001508 |
| Spectrum_000267 |
| SPECTRUM1503635 |
| Spectrum2_001574 |
| Spectrum3_000971 |
| Spectrum4_001091 |
| Spectrum5_001217 |
| SR-01000000135 |
| SR-01000000135-2 |
| SR-01000000135-3 |
| SR-01000000135-5 |
| ST012744 |
| ST2410773 |
| STK201315 |
| SW148216-2 |
| Tocris-0786 |
| Tox21_112077 |
| Tox21_112077_1 |
| Tox21_201747 |
| Tox21_302819 |
| TR-028045 |
| WLN: T5NMV DHJ BR& E1 |
| Z50145861 |
| ZINC18203737 |
US Patents and Regulatory Information for RADICAVA
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Mitsubishi Tanabe | RADICAVA | edaravone | SOLUTION;INTRAVENOUS | 209176-001 | May 5, 2017 | RX | Yes | Yes | Start Trial | Start Trial | Start Trial | ||||
| Mitsubishi Tanabe | RADICAVA | edaravone | SOLUTION;INTRAVENOUS | 209176-002 | Nov 15, 2018 | RX | Yes | Yes | Start Trial | Start Trial | Start Trial | ||||
| Mitsubishi Tanabe | RADICAVA | edaravone | SOLUTION;INTRAVENOUS | 209176-001 | May 5, 2017 | RX | Yes | Yes | Start Trial | Start Trial | Start Trial | ||||
| Mitsubishi Tanabe | RADICAVA | edaravone | SOLUTION;INTRAVENOUS | 209176-001 | May 5, 2017 | RX | Yes | Yes | Start Trial | Start Trial | Start Trial | ||||
| >Applicant | >Tradename | >Generic Name | >Dosage | >NDA | >Approval Date | >TE | >Type | >RLD | >RS | >Patent No. | >Patent Expiration | >Product | >Substance | >Delist Req. | >Exclusivity Expiration |
International Patents for RADICAVA
| Country | Patent Number | Estimated Expiration |
|---|---|---|
| World Intellectual Property Organization (WIPO) | 0234264 | Start Trial |
| European Patent Office | 1405637 | Start Trial |
| Germany | 60022560 | Start Trial |
| Spain | 2248144 | Start Trial |
| Austria | 303808 | Start Trial |
| Japan | WO2002034264 | Start Trial |
| >Country | >Patent Number | >Estimated Expiration |
