DrugPatentWatch Database Preview
RADICAVA Drug Profile
Try a free trial
See Plans and Pricing
When do Radicava patents expire, and when can generic versions of Radicava launch?
Radicava is a drug marketed by Mitsubishi Tanabe and is included in one NDA. There is one patent protecting this drug.
This drug has seven patent family members in six countries.
The generic ingredient in RADICAVA is edaravone. One supplier is listed for this compound. Additional details are available on the edaravone profile page.
Summary for RADICAVA
| International Patents: | 7 |
| US Patents: | 1 |
| Applicants: | 1 |
| NDAs: | 1 |
| Suppliers / Packagers: | 1 |
| Bulk Api Vendors: | 122 |
| Clinical Trials: | 3 |
| Patent Applications: | 973 |
| Formulation / Manufacturing: | see details |
| Drug Prices: | Drug price information for RADICAVA |
| DailyMed Link: | RADICAVA at DailyMed |
Generic Entry Opportunity Date for RADICAVA
*The generic entry opportunity date is the latter of the last compound-claiming patent and the last regulatory exclusivity protection. Many factors can influence early or later generic entry. This date is provided as a rough estimate of generic entry potential and should not be used as an independent source.
Synonyms for RADICAVA
| (MCI-186) |
| 1-Fenyl-3-methyl-2-pyrazolin-5-on |
| 1-Fenyl-3-methyl-2-pyrazolin-5-on [Czech] |
| 1-PEHNYL-3-METHYL-5-PYRAZALONE |
| 1-Phenyl-3-methyl-2-pyrazolin-5-on |
| 1-Phenyl-3-methyl-5-oxo-2-pyrazoline |
| 1-Phenyl-3-methyl-5-pyrazolone |
| 1-Phenyl-3-methylpyrazolone |
| 1-Phenyl-3-methylpyrazolone-5 |
| 115566-83-1 |
| 12235-58-4 |
| 2 4-Dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one |
| 2-Pyrazolin-5-one, 3-methyl-1-phenyl- |
| 2,4-dihydro-2-phenyl-5-methyl-3H-pyrazol-3-one |
| 2,4-Dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one |
| 206195-95-1 |
| 3-Methyl-1-phenyl-1H-pyrazol-5(4H)-one |
| 3-METHYL-1-PHENYL-2-PYRAZOLIN-5-ONE |
| 3-METHYL-1-PHENYL-2-PYRAZOLIN-5-ONE (MCI-186) |
| 3-Methyl-1-phenyl-2-pyrazolin-5-one, 99% |
| 3-methyl-1-phenyl-2-pyrazolin-5one |
| 3-Methyl-1-phenyl-2-pyrazoline-5-one |
| 3-Methyl-1-phenyl-2-pyrazoline-5-one, 99% |
| 3-Methyl-1-phenyl-2-pyrazoline-5-one, purum, >=98.0% (NT) |
| 3-Methyl-1-phenyl-2-pyrazoline-5-one, SAJ special grade |
| 3-methyl-1-phenyl-4,5-dihydro-1H-pyrazol-5-one |
| 3-Methyl-1-phenylpyrazol-5-one |
| 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl- |
| 3H-Pyrazol-3-one,4-dihydro-5-methyl-2-phenyl- |
| 4CA-0486 |
| 4E-901 |
| 5-methyl-2-phenyl-2,4-dihydro-3-pyrazolone |
| 5-Methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one |
| 5-Methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one (Edaravone) |
| 5-Methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one # |
| 5-methyl-2-phenyl-2,4-dihydro-pyrazol-3-one |
| 5-methyl-2-phenyl-2,4-dihydropyrazol-3-one |
| 5-methyl-2-phenyl-4H-pyrazol-3-one |
| 5-Pyrazolone, 3-methyl-1-phenyl- |
| 52224-17-6 |
| 62495-97-0 |
| 72134-66-8 |
| 89-25-8 |
| AB00375776_14 |
| AB00375776_15 |
| AB2000046 |
| AC-4745 |
| AC1L1H8H |
| AC1Q2PHG |
| AC1Q6EYP |
| ACT07289 |
| AE-641/00371017 |
| AI3-03557 |
| AJ-70469 |
| AK128848 |
| AKOS000313817 |
| AM20060748 |
| AN-11638 |
| Antipyrine Related Compound A, United States Pharmacopeia (USP) Reference Standard |
| BBL011741 |
| BC205186 |
| BCBcMAP01_000127 |
| BCP26336 |
| BCP9000635 |
| BCPP000246 |
| BDBM50200541 |
| Bio1_000438 |
| Bio1_000927 |
| Bio1_001416 |
| Bio2_000448 |
| Bio2_000928 |
| BRD-K35458079-001-04-2 |
| BRD-K35458079-001-12-5 |
| BRD-K35458079-001-23-2 |
| BRN 0609575 |
| BSPBio_001235 |
| BSPBio_002601 |
| C.I. Developer 1 |
| C13008 |
| CAS-89-25-8 |
| CCG-39352 |
| CCRIS 512 |
| CDS1_000986 |
| CHEBI:31530 |
| CHEMBL290916 |
| CI Developer 1 |
| CS-1832 |
| CTK3E8611 |
| D01552 |
| DB-002517 |
| DB12243 |
| Developer Z |
| DivK1c_001018 |
| DivK1c_002026 |
| DSSTox_CID_1130 |
| DSSTox_GSID_21130 |
| DSSTox_RID_75961 |
| DTXSID9021130 |
| EC 201-891-0 |
| edaravone |
| Edaravone (JP17/INN) |
| Edaravone (MCI-186) |
| Edaravone [USAN:INN] |
| edaravone(jan) |
| EINECS 201-891-0 |
| F0391-0021 |
| FT-0608243 |
| HMS1362M17 |
| HMS1792M17 |
| HMS1990M17 |
| HMS2234M19 |
| HMS3266F04 |
| HMS3403M17 |
| HMS3654L15 |
| HMS503K17 |
| HMS557M18 |
| HSDB 4102 |
| HY-B0099 |
| I01-2810 |
| IDI1_001018 |
| IDI1_002203 |
| IN1263 |
| InChI=1/C10H10N2O/c1-8-7-10(13)12(11-8)9-5-3-2-4-6-9/h2-6H,7H2,1H |
| KB-183502 |
| KBio1_001018 |
| KBio2_000575 |
| KBio2_000747 |
| KBio2_003143 |
| KBio2_003315 |
| KBio2_005711 |
| KBio2_005883 |
| KBio3_001029 |
| KBio3_001030 |
| KBio3_001821 |
| KBioGR_000575 |
| KBioGR_001502 |
| KBioSS_000575 |
| KBioSS_000747 |
| KS-00000X6I |
| KSC448M1D |
| LS-1892 |
| M0687 |
| Maybridge1_005738 |
| MCI-186 |
| MCI-186, Radicut, 89-25-8 |
| Methylphenylpyrazolone |
| MFCD00003138 |
| MLS000069602 |
| MLS001146878 |
| MLS002415675 |
| MLS006011753 |
| MolPort-000-182-197 |
| Monopyrazolone |
| NCGC00018218-01 |
| NCGC00018218-02 |
| NCGC00018218-03 |
| NCGC00018218-04 |
| NCGC00018218-05 |
| NCGC00018218-06 |
| NCGC00018218-07 |
| NCGC00018218-08 |
| NCGC00018218-10 |
| NCGC00018218-17 |
| NCGC00022665-02 |
| NCGC00022665-04 |
| NCGC00022665-05 |
| NCGC00022665-06 |
| NCGC00164015-01 |
| NCGC00256515-01 |
| NCGC00259296-01 |
| NCI-C03952 |
| NE10266 |
| NINDS_001018 |
| Norantipyrine |
| Norphenazone |
| NSC 12 |
| NSC-26139 |
| NSC-2629 |
| NSC-758622 |
| NSC26139 |
| NSC2629 |
| NSC758622 |
| Opera_ID_1057 |
| Pharmakon1600-01503635 |
| Phenazone impurity A, European Pharmacopoeia (EP) Reference Standard |
| Phenyl methyl pyrazolone |
| Phenylmethylpyrazolone |
| PubChem13301 |
| Q-200386 |
| QELUYTUMUWHWMC-UHFFFAOYSA-N |
| Radicava (TN) |
| Radicut |
| Radicut (TN) |
| Radicut;MCI-186 |
| RL05601 |
| RTR-028045 |
| s1326 |
| SB19128 |
| SBI-0051836.P002 |
| SC-13582 |
| SCHEMBL4704 |
| SMR000059020 |
| SPBio_001508 |
| Spectrum_000267 |
| SPECTRUM1503635 |
| Spectrum2_001574 |
| Spectrum3_000971 |
| Spectrum4_001091 |
| Spectrum5_001217 |
| SR-01000000135 |
| SR-01000000135-2 |
| SR-01000000135-3 |
| SR-01000000135-5 |
| ST012744 |
| ST2410773 |
| STK201315 |
| SW148216-2 |
| Tocris-0786 |
| Tox21_112077 |
| Tox21_112077_1 |
| Tox21_201747 |
| Tox21_302819 |
| TR-028045 |
| WLN: T5NMV DHJ BR& E1 |
| Z50145861 |
| ZINC18203737 |
US Patents and Regulatory Information for RADICAVA
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Mitsubishi Tanabe | RADICAVA | edaravone | SOLUTION;INTRAVENOUS | 209176-001 | May 5, 2017 | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Mitsubishi Tanabe | RADICAVA | edaravone | SOLUTION;INTRAVENOUS | 209176-002 | Nov 15, 2018 | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Mitsubishi Tanabe | RADICAVA | edaravone | SOLUTION;INTRAVENOUS | 209176-001 | May 5, 2017 | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| Mitsubishi Tanabe | RADICAVA | edaravone | SOLUTION;INTRAVENOUS | 209176-001 | May 5, 2017 | RX | Yes | Yes | ➤ Sign Up | ➤ Sign Up | ➤ Sign Up | ||||
| >Applicant | >Tradename | >Generic Name | >Dosage | >NDA | >Approval Date | >TE | >Type | >RLD | >RS | >Patent No. | >Patent Expiration | >Product | >Substance | >Delist Req. | >Exclusivity Expiration |
International Patents for RADICAVA
| Country | Patent Number | Estimated Expiration |
|---|---|---|
| European Patent Office | 1405637 | ➤ Sign Up |
| World Intellectual Property Organization (WIPO) | 0234264 | ➤ Sign Up |
| Japan | 3758164 | ➤ Sign Up |
| Japan | WO2002034264 | ➤ Sign Up |
| Germany | 60022560 | ➤ Sign Up |
| Spain | 2248144 | ➤ Sign Up |
| Austria | 303808 | ➤ Sign Up |
| >Country | >Patent Number | >Estimated Expiration |
