DrugPatentWatch Database Preview
PAROEX Drug Profile
see a sample report or, see our see our flat-rate plans
When do Paroex patents expire, and when can generic versions of Paroex launch?
The generic ingredient in PAROEX is chlorhexidine gluconate. There are fifty-seven drug master file entries for this compound. Sixty-five suppliers are listed for this compound. Additional details are available on the chlorhexidine gluconate profile page.
Summary for PAROEX
| US Patents: | 0 |
| Applicants: | 1 |
| NDAs: | 1 |
| Suppliers / Packagers: | 2 |
| Bulk Api Vendors: | 29 |
| Clinical Trials: | 1 |
| Patent Applications: | 4,339 |
| Formulation / Manufacturing: | see details |
| DailyMed Link: | PAROEX at DailyMed |
Pharmacology for PAROEX
| Physiological Effect | Decreased Cell Wall Integrity |
Medical Subject Heading (MeSH) Categories for PAROEX
Synonyms for PAROEX
| (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylene]amino]methylene]amino]hexyl]-1-[amino-(4-chloroanilino)methylene]guanidine; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| 1-(4-chlorophenyl)-3-[N-[6-[[N-[N-(4-chlorophenyl)carbamimidoyl]carbamimidoyl]amino]hexyl]carbamimidoyl]guanidine; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| 1,1'-Hexamethylene bis(5-(p-chlorophenyl)biguanide), digluconate |
| 1,1'-Hexamethylenebis[5-(4-chlorophenyl)biguanide] Digluconate |
| 1,6-Bis(N5-[p-chlorophenyl]-N1-biguanido)hexane; 1,1 inverted exclamation marka-Hexamethylenebis(5-[p-chlorophenyl]biguanide) |
| 1,6-Bis(N5-[p-chlorophenyl]-N1-biguanido)hexane; 1,1'-Hexamethylenebis(5-[p-chlorophenyl]biguanide) |
| 105791-72-8 |
| 12068-31-4 |
| 124973-71-3 |
| 14007-07-9 |
| 150621-85-5 |
| 151498-43-0 |
| 18472-51-0 |
| 2,4,11,13-Tetraazatetradecanediimidamide, N,N''-bis(4-chlorophenyl)-3,12-diimino-, digluconate |
| 21293-24-3 |
| 227749-99-7 |
| 230296-52-3 |
| 23289-58-9 |
| 40330-16-3 |
| 452971-25-4 |
| 51365-13-0 |
| 52196-45-9 |
| 52387-19-6 |
| 60042-57-1 |
| 60404-86-6 |
| 82432-16-4 |
| 906339-38-6 |
| Abacil |
| AKOS015896303 |
| AKOS025310696 |
| AN-18792 |
| Arlacide G |
| Bioscrub |
| Brian Care |
| C08038 |
| CHEBI:28312 |
| Chlorhexidin glukonatu |
| Chlorhexidine D-digluconate |
| Chlorhexidine di-D-gluconate |
| CHLORHEXIDINE DIGLUCONATE |
| Chlorhexidine digluconate solution |
| Chlorhexidine digluconate solution, 20% in H2O |
| Chlorhexidine digluconate, 20% w/v aqueous solution |
| Chlorhexidine digluconate, pharmaceutical secondary standard; traceable to USP and PhEur |
| Chlorhexidine gluconate |
| Chlorhexidine gluconate (JP17/USP) |
| Chlorhexidine gluconate [USAN:USP:JAN] |
| Chx plus concentrate premium chlorhexidine teat dip concentrate |
| Cida-Stat |
| D-Gluconic acid, compd with N,N''-bis(4-chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide (2:1) |
| D-Gluconic acid, compd. with N,N''-bis(4-chlorophenyl) -3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide (2:1) |
| D-Gluconic acid, compd. with N1,N14-bis(4-chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide (2:1) |
| D00858 |
| DTXSID5034519 |
| Dyna-hex |
| EC 242-354-0 |
| Exidine |
| Fight bac |
| Gluconic acid, compd. with 1,1'-hexamethylene bis(5-(p-chlorophenyl)biguanide) (2:1), D- (8CI) |
| Hibiclens |
| Hibiclens (TN) |
| Hibidil |
| Hibiscrub |
| Hibitane |
| Hibitane gluconate |
| I06-2074 |
| J-011837 |
| Kleersight |
| M166 |
| MFCD00083599 |
| Microderm |
| MolPort-006-069-426 |
| MOR84MUD8E |
| N',N'''''-hexane-1,6-diylbis[N-(4-chlorophenyl)(imidodicarbonimidic diamide)]--D-gluconic acid (1/2) |
| Peridex |
| Peridex (TN) |
| Periochip |
| Periogard |
| Periogard (TN) |
| Pharmaseal Scrub Care |
| pHiso-Med |
| Prevacare |
| Prevacare R |
| SCHEMBL34468 |
| Steri-Stat |
| UNII-MOR84MUD8E |
| Unisept |
US Patents and Regulatory Information for PAROEX
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sunstar Americas | PAROEX | chlorhexidine gluconate | SOLUTION;DENTAL | 076434-001 | Nov 29, 2005 | AT | RX | No | No | ➤ Try a Free Trial | ➤ Try a Free Trial | ➤ Try a Free Trial | |||
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
see a sample report or, see our see our flat-rate plans
see a sample report or, see our see our flat-rate plans
