DrugPatentWatch Database Preview
Ibuprofen - Generic Drug Details
What are the generic sources for ibuprofen and what is the scope of patent protection?
Ibuprofen
is the generic ingredient in forty-four branded drugs marketed by Glaxosmithkline, Amneal Pharms, Ascent Pharms Inc, Aurobindo Pharma Ltd, Bionpharma Inc, Contract Pharmacal, Humanwell Puracap, Marksans Pharma, P And L Dev Llc, Sofgen Pharms, Strides Pharma, Bayer, Cumberland Pharms, J And J Consumer Inc, Guardian Drug, L Perrigo Co, Tris Pharma Inc, Mcneil, Moberg Pharma North, Perrigo, Abbott, Actavis Mid Atlantic, Aptapharma Inc, Arise, Hi Tech, P And L, Taro, Mcneil Consumer, Mcneil Ped, Lederle, Basf, Alra, Pliva, Amneal Pharms Ny, Ani Pharms Inc, Aurolife Pharma Llc, Avema Pharma, Dr Reddys La, Dr Reddys Labs Inc, Granules India, Granules India Ltd, Halsey, Hec Pharm, Ivax Sub Teva Pharms, Leiner, LNK, Merro Pharm, Mylan, Northstar Hlthcare, OHM, Ohm Labs, Par Pharm, Perrigo Pharms Co, Perrigo R And D, Purepac Pharm, Sandoz, Shandong Xinhua, Sun Pharm Industries, Superpharm, Teva, Ultratab Labs Inc, Vintage Pharms, Watson Labs, Bristol Myers, X-gen Pharms Inc, Recordati Rare, Forest Labs, Actavis Elizabeth, Barr Labs Inc, and Dr Reddys Labs Ltd, and is included in two hundred and sixteen NDAs. There are fifteen patents protecting this compound. Additional information is available in the individual branded drug profile pages.Ibuprofen has sixty-two patent family members in eighteen countries.
There are sixty-four drug master file entries for ibuprofen. Two hundred and twenty-six suppliers are listed for this compound.
Summary for ibuprofen
| International Patents: | 62 |
| US Patents: | 15 |
| Tradenames: | 44 |
| Applicants: | 70 |
| NDAs: | 216 |
| Drug Master File Entries: | 64 |
| Suppliers / Packagers: | 226 |
| Bulk Api Vendors: | 160 |
| Clinical Trials: | 643 |
| Patent Applications: | 8,734 |
| Formulation / Manufacturing: | see details |
| Drug Prices: | Drug price trends for ibuprofen |
| Drug Sales Revenues: | Drug sales revenues for ibuprofen |
| Patent Litigation and PTAB cases: | See patent lawsuits and PTAB cases for ibuprofen |
| DailyMed Link: | ibuprofen at DailyMed |
Recent Clinical Trials for ibuprofen
Identify potential brand extensions & 505(b)(2) entrants
| Sponsor | Phase |
|---|---|
| Ontario Institute for Cancer Research | Phase 2 |
| Walter Reed National Military Medical Center | Phase 3 |
| Northwestern University | Phase 4 |
Recent Litigation for ibuprofen
Identify potential future generic entrants
PTAB Litigation
| Petitioner | Date |
|---|---|
| 2012-12-04 |
Pharmacology for ibuprofen
| Drug Class | Nonsteroidal Anti-inflammatory Drug |
| Mechanism of Action | Cyclooxygenase Inhibitors |
Medical Subject Heading (MeSH) Categories for ibuprofen
Synonyms for ibuprofen
| .alpha.-(4-Isobutylphenyl)propionic acid |
| .alpha.-(p-isobutylphenyl)propionic acid |
| .alpha.-2-(p-Isobutylphenyl)propionic acid |
| .alpha.-Methyl-4-(2-methylpropyl)benzeneacetic acid |
| ( inverted exclamation markA)-Ibuprofen |
| ( inverted question mark)-Ibuprofen |
| (? inverted exclamation markA)-2-(4-Isobutylphenyl)Propanoic Acid |
| (?)-Ibuprofen |
| (.+-.)-2-(p-Isobutylphenyl)propionic acid |
| (.+-.)-p-Isobutylhydratropic acid |
| (.+/-.)-2-(p-Isobutylphenyl)propionic acid |
| (.+/-.)-p-Isobutylhydratropic acid |
| (+-)-2-(p-Isobutylphenyl)propionic acid |
| (+-)-alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid |
| (+-)-Ibuprofen |
| (+-)-Ibuprophen |
| (+-)-p-Isobutylhydratropic acid |
| (+) ibuprofen |
| (+/-)-2-(4-Isobutylphenyl)Propanoic Acid |
| (+/-)-2-(p-isobutylphenyl)propionic acid |
| (+/-)-alpha-methyl-4-(2-methylpropyl)benzeneacetic acid |
| (+/-)-Ibuprofen |
| (+/-)-p-Isobutylhydratropic acid |
| (2s)-2-[4-(2-methylpropyl)phenyl]propionic acid DEXIBUPROFEN (S)-(+)-2-(4-ISOBUTYLPHENYL)PROPIONIC ACID (S)-(+)-4-ISOBUTYL-ALPHA-ME |
| (4-Isobutylphenyl)-alpha-methylacetic acid |
| (A+/-)-Ibuprofen |
| (R)-Ibuprofen |
| (r/s)-alpha-methyl-4-isobutylphenylacetic acid |
| (RS)-2-(4-(2-Methylpropyl)phenyl)propanoic acid |
| (RS)-Ibuprofen |
| (S)-4-Isobutyl-alpha-methylphenylacetic acid |
| (y)-Ibuprofen |
| [(+/-)-2-(4-Isobutylphenyl)-propionic Acid |
| 139466-08-3 |
| 15687-27-1 |
| 2-(4-Isobutyl-phenyl)-propionic acid |
| 2-(4-isobutylphenyl) propanoic acid |
| 2-(4-isobutylphenyl) propionic acid |
| 2-(4-isobutylphenyl)-propionic acid |
| 2-(4-Isobutylphenyl)-propionic acid ; alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid ; p-Isobutylhydratropic acid |
| 2-(4-isobutylphenyl)-propionoic acid |
| 2-(4-Isobutylphenyl)propanoic acid |
| 2-(4-Isobutylphenyl)propanoicAcid |
| 2-(4-ISOBUTYLPHENYL)PROPIONIC ACID |
| 2-(4'-isobutylphenyl)-propionic acid |
| 2-(4'-isobutylphenyl)propionic acid |
| 2-(p-Isobutylphenyl)propionic acid |
| 2-[4-(2-methylpropyl)phenyl]propanoic acid |
| 2-p-isobutylphenylpropionic acid |
| 31121-93-4 (hydrochloride salt) |
| 4-Isobutyl-.alpha.-methylphenylacetic acid |
| 4-Isobutyl-alpha-methylphenylacetic acid |
| 4-Isobutylhydratropic acid |
| 4-Isobutylphenyl)-.alpha.-methylacetic acid |
| 58560-75-1 |
| 687I271 |
| 79261-49-7 (potassium salt) |
| A831926 |
| AB00052020_18 |
| AB00052020_19 |
| AB00052020-16 |
| AB00052020-17 |
| AB1009266 |
| AC-11312 |
| AC1L1GGE |
| AC1Q1P84 |
| AC1Q1P85 |
| ACHES-N-PAIN |
| Acide (isobutyl-4 phenyl)-2 propionique |
| Acide (isobutyl-4-phenyl)-2 propionique |
| Acide (isobutyl-4-phenyl)-2 propionique [French] |
| ACMC-209df0 |
| ACMC-209ks2 |
| Act-3 |
| ACT03248 |
| Actiprofen |
| Adex 200 |
| Adran |
| Advil |
| Advil (TN) |
| Advil Cold & Sinus (Salt/Mix) |
| Advil Liqui-Gels |
| Advil migraine |
| Advil Migraine Liqui-Gels |
| Advil, Children's |
| AK-47272 |
| Ak+C2278tren |
| AKOS003237488 |
| AKOS016340658 |
| Aktren |
| Alaxan |
| ALBB-025647 |
| Algofen |
| Alivium |
| alpha-(4-isobutylphenyl)-propionic acid |
| alpha-(4-Isobutylphenyl)propionate |
| alpha-(4-Isobutylphenyl)propionic acid |
| alpha-(p-isobutylphenyl)-propionic acid |
| alpha-(p-isobutylphenyl)propionic acid |
| alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid |
| alpha-Methyl-4-(isobutyl)phenylacetic acid |
| alpha-Methyl-4-[2-methylpropyl] benzeneacetic Acid |
| alpha-p-Isobutylphenylpropionate |
| alpha-p-Isobutylphenylpropionic acid |
| Am-Fam 400 |
| AM20060782 |
| Amelior |
| Amersol |
| Amibufen |
| AN-18584 |
| Anafen |
| Anco |
| Andran |
| Anflagen |
| Antagil |
| Antalfene |
| Antarene |
| Antiflam |
| ANW-21658 |
| Apo-Ibuprofen |
| Apsifen |
| Apsifen-F |
| ARONIS23835 |
| Artofen |
| Artril |
| Artril 300 |
| Balkaprofen |
| Bayer Select Pain Relief |
| BB 0258487 |
| BBL010660 |
| BCP10423 |
| BCP20325 |
| BCP25225 |
| BDBM50009859 |
| Benzeneacetic acid, .alpha.-methyl-4-(2-methylpropyl)- |
| Benzeneacetic acid, .alpha.-methyl-4-(2-methylpropyl), (.+/-.)- |
| Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl)- |
| Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl), (+-)- |
| Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl), (+/-)- |
| Betaprofen |
| BIDD:GT0050 |
| Bloom |
| Bluton |
| BR-47272 |
| BRD-A17655518-001-02-0 |
| BRD-A17655518-001-12-9 |
| BRN 2049713 |
| Brofen |
| Brufanic |
| Brufen |
| Brufen 400 |
| Brufen Retard |
| Bruflam |
| Brufort |
| BSPBio_002170 |
| Buburone |
| Bufeno |
| Bufigen |
| Bukrefen |
| Bupron |
| Buracaps |
| Burana |
| Butacortelone |
| Butylenin |
| C01588 |
| C13H18O2 |
| Caldolor |
| Cambridge id 5152402 |
| Cap-Profen |
| Carol |
| CAS-15687-27-1 |
| CBMicro_005634 |
| CCG-38947 |
| CCRIS 3223 |
| CDT-ibuprofen |
| Cesra |
| CHEBI:5855 |
| CHEMBL521 |
| Children's Advil |
| CHILDREN'S ADVIL-FLAVORED |
| Children's Elixsure |
| Children's Elixsure IB |
| Children's Elixsure IB (Salt/Mix) |
| Children's Ibuprofen |
| Children's Motrin |
| Citalgan |
| Cobo |
| Codral |
| Codral Period Pain |
| Combiflam |
| Combunox (Salt/Mix) |
| CPD000058184 |
| CS-1931 |
| CTK3J2010 |
| Cunil |
| D00126 |
| Daiprophen |
| Dalsy |
| Dansida |
| DB01050 |
| Deep Relief |
| Dentigoa |
| Dibufen |
| Dignoflex |
| DivK1c_000887 |
| Dolgin |
| Dolgirid |
| Dolgit |
| Dolibu |
| Dolmaral |
| DOLO PUREN |
| Dolo-Dolgit |
| Dolocyl |
| Dolofen |
| Dolofen-F |
| Dolofin |
| Dolofort |
| Dologel |
| Dolomax |
| Doloren |
| Dolormin |
| Doltibil |
| Dolven |
| Donjust B |
| Dorival |
| Drin |
| DSSTox_CID_732 |
| DSSTox_GSID_20732 |
| DSSTox_RID_75759 |
| DTXSID5020732 |
| Duafen |
| Dularbuprofen |
| Duobrus |
| Dura-Ibu |
| duralbuprofen |
| Dysdolen |
| Easifon |
| Ebufac |
| EC 239-784-6 |
| EINECS 239-784-6 |
| Emflam |
| Emflam-200 |
| Epitope ID:139973 |
| Epobron |
| Eputex |
| Ergix |
| Esprenit |
| EU-0100691 |
| Exneural |
| Faspic |
| Femadon |
| Femafen |
| Femapirin |
| Femidol |
| Fenbid |
| Fenbid Spansule |
| Fendol |
| Fenspan |
| Fibraflex |
| FT-0601629 |
| FT-0655194 |
| Gelufene |
| Genpril |
| Gofen |
| Grefen |
| GTPL2713 |
| Gynofug |
| Haltran |
| HEFNNWSXXWATRW-UHFFFAOYSA- |
| HEFNNWSXXWATRW-UHFFFAOYSA-N |
| Hemagene Tailleur |
| HMS1920F15 |
| HMS2089P05 |
| HMS2091N03 |
| HMS2230N04 |
| HMS3259G05 |
| HMS3262K03 |
| HMS3372M09 |
| HMS3649M11 |
| HMS3651A15 |
| HMS502M09 |
| HSDB 3099 |
| HY-78131 |
| Hydratropic acid, p-isobutyl- |
| I 4883 |
| I01-7039 |
| I0415 |
| IB-100 |
| Ibol |
| Ibren |
| Ibu |
| Ibu-Attritin |
| Ibu-slo |
| Ibu-slow |
| Ibu-Tab |
| Ibu-Tab 200 |
| Ibubest |
| Ibubeta |
| Ibucasen |
| Ibudol |
| Ibudolor |
| Ibufen |
| Ibuflamar |
| Ibufug |
| Ibugel |
| Ibugen |
| Ibugesic |
| Ibuhexal |
| Ibulagic |
| Ibular |
| Ibulav |
| Ibuleve |
| Ibulgan |
| Ibumed |
| Ibumerck |
| Ibumetin |
| Ibup |
| Ibupirac |
| Ibupril |
| Ibuprin |
| Ibuprocin |
| Ibuprofen - Adooq Bioscience |
| Ibuprofen (Advil) |
| Ibuprofen (Dolgesic) |
| Ibuprofen (JP17/USP/INN) |
| Ibuprofen [USAN:BAN:INN:JAN] |
| Ibuprofen [USAN:USP:INN:BAN:JAN] |
| Ibuprofen 1.0 mg/ml in Methanol |
| Ibuprofen for peak identification, European Pharmacopoeia (EP) Reference Standard |
| Ibuprofen I.V. Solution |
| IBUPROFEN USP GRADE |
| Ibuprofen-Zinc |
| Ibuprofen, >=98% (GC) |
| Ibuprofen, 99% |
| Ibuprofen, British Pharmacopoeia (BP) Reference Standard |
| Ibuprofen, European Pharmacopoeia (EP) Reference Standard |
| Ibuprofen, meets USP testing specifications |
| Ibuprofen, Pharmaceutical Secondary Standard; Certified Reference Material |
| Ibuprofen, United States Pharmacopeia (USP) Reference Standard |
| Ibuprofen, Vetec(TM) reagent grade, 97% |
| Ibuprofen, VETRANAL(TM), analytical standard |
| Ibuprofen,(S) |
| Ibuprofene |
| Ibuprofene [INN-French] |
| Ibuprofeno |
| Ibuprofeno [INN-Spanish] |
| Ibuprofenum |
| Ibuprofenum [INN-Latin] |
| Ibuprohm |
| Ibuprophen |
| Ibuprox |
| Ibusal |
| Ibutid |
| Ibux |
| IDI1_000887 |
| Ifen |
| Inabrin |
| InChI=1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) |
| Inflam |
| Inoven |
| IP-82 |
| Ipren |
| Irfen |
| Isobutylpropanoicphenolic acid |
| Isodol |
| J-009349 |
| J10135 |
| Jenaprofen |
| Junifen |
| Junior Strength Advil |
| Junior Strength Ibuprofen |
| Junior Strength Motrin |
| KB-222912 |
| KBio1_000887 |
| KBio2_001329 |
| KBio2_003897 |
| KBio2_006465 |
| KBio3_001390 |
| KBioGR_000389 |
| KBioSS_001329 |
| Kesan |
| Kontagripp Mono |
| Kratalgin |
| KS-00000CJ0 |
| KS-000047NV |
| KS-5029 |
| KSC492A1B |
| Lamidon |
| Lebrufen |
| Librofem |
| Lidifen |
| Liptan |
| Lopac0_000691 |
| Lopane |
| LP00691 |
| LS-7454 |
| M-4957 |
| Malafene |
| Manypren |
| MCULE-9475454445 |
| Medipren |
| Melfen |
| Mensoton |
| MFCD00010393 |
| Midol |
| Midol 200 |
| Midol IB Cramp Relief |
| Midol Liquid Gels |
| MLS000069733 |
| MLS001146965 |
| MolPort-001-791-802 |
| Moment |
| Motrin |
| Motrin (TN) |
| Motrin IB |
| Motrin IB Gelcaps |
| Motrin IB Gelcaps (Salt/Mix) |
| MOTRIN MIGRAINE PAIN |
| Mynosedin |
| N4,N4' -Di(naphthalen-1-yl)-N4,N4' -bis(4-vinylphenyl)biphenyl-4,4'-diamine |
| Nagifen-D |
| Napacetin |
| Narfen |
| NC00458 |
| NCGC00015529-04 |
| NCGC00015529-05 |
| NCGC00015529-06 |
| NCGC00015529-07 |
| NCGC00015529-08 |
| NCGC00015529-09 |
| NCGC00015529-10 |
| NCGC00015529-12 |
| NCGC00015529-13 |
| NCGC00015529-14 |
| NCGC00015529-15 |
| NCGC00015529-18 |
| NCGC00089819-02 |
| NCGC00089819-03 |
| NCGC00089819-04 |
| NCGC00089819-05 |
| NCGC00089819-06 |
| NCGC00089819-07 |
| NCGC00256416-01 |
| NCGC00258935-01 |
| NCGC00261376-01 |
| NCI60_002065 |
| Neo-Helvagit |
| Neo-Mindol |
| Neobrufen |
| Nerofen |
| NINDS_000887 |
| Noalgil |
| Nobafon |
| Nobfelon |
| Nobfen |
| Nobgen |
| Noritis |
| Novadol |
| Novo Dioxadol |
| Novo-Profen |
| Novogent |
| Novogent N |
| Novoprofen |
| NSC 256857 |
| NSC-256857 |
| NSC-757073 |
| NSC256857 |
| NSC757073 |
| Nuprilan |
| Nuprin |
| Nurofen |
| Nurofen Meltlets |
| Opera_ID_554 |
| Optifen |
| Opturem |
| Oralfene |
| Ostarin |
| Ostofen |
| Ozonol |
| p-Isobutyl-2-phenylpropionate |
| p-Isobutyl-2-phenylpropionic acid |
| p-isobutyl-hydratropic acid |
| p-Isobutylhydratropate |
| p-Isobutylhydratropic acid |
| Paduden |
| Panafen |
| Pantrop |
| Para-Isobutylhydratropic Acid |
| Paxofen |
| Pedea |
| Pedia-Profen |
| PediaProfen |
| Pediatric Advil |
| Perofen |
| Perrigo ibuprofen |
| Pharmakon1600-01500347 |
| Proartinal |
| Profen |
| Proflex |
| Propanoic acid, 2-(4-isobutylphenyl) |
| Provon |
| PubChem16054 |
| Quadrax |
| R.D. 13621 |
| Racemic ibuprofen |
| Rafen |
| Ranofen |
| RD 13621 |
| Rebugen |
| Relcofen |
| Rhinadvil |
| Rofen |
| Roidenin |
| RP26239 |
| RTR-006580 |
| Rufen |
| Rufin |
| Rupan |
| s1638 |
| Sadefen |
| Salivia |
| Salprofen |
| SAM002264619 |
| SB19113 |
| SBB064160 |
| SBI-0050669.P004 |
| SC-18867 |
| SCHEMBL3001 |
| Schmerz-Dolgit |
| Seclodin |
| Sednafen |
| Seklodin |
| Seskafen |
| Sine-Aid IB Caplets (Salt/Mix) |
| Siyafen |
| SMR000058184 |
| Solpaflex |
| Solufen |
| SPBio_000178 |
| Spectrum_000849 |
| SPECTRUM1500347 |
| Spectrum2_000129 |
| Spectrum3_000465 |
| Spectrum4_000015 |
| Spectrum5_000862 |
| SR-01000000214 |
| SR-01000000214-13 |
| SR-01000000214-2 |
| SR-01000000214-4 |
| ST-1482 |
| ST024750 |
| ST24032335 |
| Stelar |
| STK177358 |
| Sugafen |
| Suprafen |
| Suspren |
| SW203738-2 |
| Syntofene |
| Tab-Profen |
| Tabalon |
| Tabalon 400 |
| Tatanal |
| Tempil |
| TL8001184 |
| Tofen |
| Togal N |
| Tonal |
| Tox21_110170 |
| Tox21_110170_1 |
| Tox21_201384 |
| Tox21_302829 |
| Tox21_500691 |
| TR-006580 |
| TRA0047278 |
| Trauma-Dolgit Gel |
| Trendar |
| U 18573 |
| U-18,573 |
| U-18573 |
| UCB 79171 |
| Unipron |
| Upfen |
| Uprofen |
| Urem |
| VUFB 9649 |
| WLN: QVY&R DIY |
| Z1695709473 |
| Zafen |
| ZAG-1701 |
| Zofen |
Paragraph IV (Patent) Challenges for IBUPROFEN
| Tradename | Dosage | Ingredient | NDA | Submissiondate |
|---|---|---|---|---|
| JUNIOR STRENGTH MOTRIN | TABLET, CHEWABLE;ORAL | ibuprofen | 020601 | |
| CHILDREN'S MOTRIN | SUSPENSION/DROPS;ORAL | ibuprofen | 020603 | |
| CHILDREN'S MOTRIN | TABLET, CHEWABLE;ORAL | ibuprofen | 020601 |
US Patents and Regulatory Information for ibuprofen
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | TE | Type | RLD | RS | Patent No. | Patent Expiration | Product | Substance | Delist Req. | Exclusivity Expiration |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Mylan | IBUPROFEN | ibuprofen | TABLET;ORAL | 070057-001 | Sep 24, 1985 | DISCN | No | No | Start Trial | Start Trial | Start Trial | ||||
| Northstar Hlthcare | IBUPROFEN | ibuprofen | TABLET;ORAL | 078132-002 | Sep 10, 2007 | DISCN | No | No | Start Trial | Start Trial | Start Trial | ||||
| Recordati Rare | NEOPROFEN | ibuprofen lysine | INJECTABLE;INTRAVENOUS | 021903-001 | Apr 13, 2006 | AP | RX | Yes | Yes | Start Trial | Start Trial | Y | Start Trial | ||
| Amneal Pharms Ny | IBUPROFEN | ibuprofen | TABLET;ORAL | 071335-001 | Nov 25, 1986 | AB | RX | No | No | Start Trial | Start Trial | Start Trial | |||
| >Applicant | >Tradename | >Generic Name | >Dosage | >NDA | >Approval Date | >TE | >Type | >RLD | >RS | >Patent No. | >Patent Expiration | >Product | >Substance | >Delist Req. | >Exclusivity Expiration |
Expired US Patents for ibuprofen
| Applicant | Tradename | Generic Name | Dosage | NDA | Approval Date | Patent No. | Patent Expiration |
|---|---|---|---|---|---|---|---|
| J And J Consumer Inc | JUNIOR STRENGTH MOTRIN | ibuprofen | TABLET, CHEWABLE;ORAL | 020601-003 | Nov 15, 1996 | Start Trial | Start Trial |
| Bionpharma Inc | MIDOL LIQUID GELS | ibuprofen | CAPSULE;ORAL | 021472-001 | Oct 18, 2002 | Start Trial | Start Trial |
| Glaxosmithkline | CHILDREN'S ADVIL | ibuprofen | SUSPENSION;ORAL | 020589-001 | Jun 27, 1996 | Start Trial | Start Trial |
| Mcneil Ped | MOTRIN | ibuprofen | TABLET, CHEWABLE;ORAL | 020135-002 | Nov 16, 1994 | Start Trial | Start Trial |
| >Applicant | >Tradename | >Generic Name | >Dosage | >NDA | >Approval Date | >Patent No. | >Patent Expiration |
International Patents for ibuprofen
| Country | Patent Number | Estimated Expiration |
|---|---|---|
| South Korea | 20180063901 | Start Trial |
| Brazil | PI0925034 | Start Trial |
| Australia | 2016203946 | Start Trial |
| Denmark | 2825039 | Start Trial |
| >Country | >Patent Number | >Estimated Expiration |
Make Better Decisions: Try a trial or see plans & pricing
Serving leading biopharmaceutical companies globally:
Drugs may be covered by multiple patents or regulatory protections. All trademarks and applicant names are the property of their respective owners or licensors. Although great care is taken in the proper and correct provision of this service, thinkBiotech LLC does not accept any responsibility for possible consequences of errors or omissions in the provided data. The data presented herein is for information purposes only. There is no warranty that the data contained herein is error free. thinkBiotech performs no independent verifification of facts as provided by public sources nor are attempts made to provide legal or investing advice. Any reliance on data provided herein is done solely at the discretion of the user. Users of this service are advised to seek professional advice and independent confirmation before considering acting on any of the provided information. thinkBiotech LLC reserves the right to amend, extend or withdraw any part or all of the offered service without notice.
Copyright 2002-2020 thinkBiotech LLC
ISSN: 2162-2639
Privacy and Cookies
Terms & Conditions
Site Map
DrugPatentWatch Alternatives
LOE / Major Patent Expirations 2020 - 2021
NCE-1 Patent Challenge Dates 2020 - 2021
ISSN: 2162-2639
Privacy and Cookies
Terms & Conditions
Site Map
DrugPatentWatch Alternatives
LOE / Major Patent Expirations 2020 - 2021
NCE-1 Patent Challenge Dates 2020 - 2021
Preferred Citation:
Friedman, Yali. "DrugPatentWatch" DrugPatentWatch, thinkBiotech, 2020, www.DrugPatentWatch.com.
Follow DrugPatentWatch:
